Difference between revisions of "1-PHOSPHATIDYL-1D-MYO-INOSITOL-34-BISPH"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Enoylpimeloyl-ACP-methyl-esters == * common-name: ** an enoylpimeloyl-[acp] methyl ester == Reaction(s) known to consume the compound ==...") |
(Created page with "Category:metabolite == Metabolite CYSTINE == * common_name: ** l-cystine * smiles: ** c(c(c(=o)[o-])[n+])sscc(c([o-])=o)[n+] * inchi_key: ** inchikey=levwyrkdkasidu-imjsid...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CYSTINE == |
| − | * | + | * common_name: |
| − | ** | + | ** l-cystine |
| + | * smiles: | ||
| + | ** c(c(c(=o)[o-])[n+])sscc(c([o-])=o)[n+] | ||
| + | * inchi_key: | ||
| + | ** inchikey=levwyrkdkasidu-imjsidkusa-n | ||
| + | * molecular_weight: | ||
| + | ** 240.292 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[CYSTHIOCYS-RXN]] |
| + | * [[RXN-15128]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-15128]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: | + | {{#set: common_name=l-cystine}} |
| + | {{#set: inchi_key=inchikey=levwyrkdkasidu-imjsidkusa-n}} | ||
| + | {{#set: molecular_weight=240.292 }} | ||
Revision as of 17:50, 13 January 2021
Contents
Metabolite CYSTINE
- common_name:
- l-cystine
- smiles:
- c(c(c(=o)[o-])[n+])sscc(c([o-])=o)[n+]
- inchi_key:
- inchikey=levwyrkdkasidu-imjsidkusa-n
- molecular_weight:
- 240.292
