Difference between revisions of "Microtubules"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite EDTA == * common_name: ** edta * smiles: ** c(c[n+](cc([o-])=o)cc([o-])=o)[n+](cc([o-])=o)cc([o-])=o * inchi_key: ** inchikey=kcxvzyzypll...") |
(Created page with "Category:metabolite == Metabolite RIBULOSE-5P == * common-name: ** d-ribulose 5-phosphate * molecular-weight: ** 228.095 * inchi-key: ** fnzlkvnuwiipsj-uhnvwzdzsa-l * smil...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite RIBULOSE-5P == |
− | * | + | * common-name: |
− | ** | + | ** d-ribulose 5-phosphate |
+ | * molecular-weight: | ||
+ | ** 228.095 | ||
+ | * inchi-key: | ||
+ | ** fnzlkvnuwiipsj-uhnvwzdzsa-l | ||
* smiles: | * smiles: | ||
− | ** c(c | + | ** c(c(c(c(co)=o)o)o)op([o-])([o-])=o |
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[DIOHBUTANONEPSYN-RXN]] |
− | * [[ | + | * [[PHOSPHORIBULOKINASE-RXN]] |
+ | * [[RIB5PISOM-RXN]] | ||
+ | * [[RIBULP3EPIM-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[6PGLUCONDEHYDROG-RXN]] |
− | * [[ | + | * [[PHOSPHORIBULOKINASE-RXN]] |
+ | * [[RIB5PISOM-RXN]] | ||
+ | * [[RIBULP3EPIM-RXN]] | ||
+ | * [[RXN-3341]] | ||
+ | * [[RXN-9952]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: | + | {{#set: common-name=d-ribulose 5-phosphate}} |
− | {{#set: | + | {{#set: molecular-weight=228.095}} |
− | {{#set: | + | {{#set: inchi-key=inchikey=fnzlkvnuwiipsj-uhnvwzdzsa-l}} |
Revision as of 17:52, 13 January 2021
Contents
Metabolite RIBULOSE-5P
- common-name:
- d-ribulose 5-phosphate
- molecular-weight:
- 228.095
- inchi-key:
- fnzlkvnuwiipsj-uhnvwzdzsa-l
- smiles:
- c(c(c(c(co)=o)o)o)op([o-])([o-])=o