Difference between revisions of "2-Hexadecenoyl-ACPs"

Revision as of 17:54, 13 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite LINOLENOYL-COA ==
+== Metabolite Ox-Thioredoxin ==
 * common-name:
-** &alpha;-linolenoyl-coa
+** an oxidized thioredoxin
-* molecular-weight:
-** 1023.921
-* inchi-key:
-** omkfkbgzhnjnex-kzwmewpfsa-j
-* smiles:
-** ccc=ccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)([o-])op(=o)([o-])occ3(oc(n2(c=nc1(c(n)=nc=nc=12)))c(o)c(op(=o)([o-])[o-])3)
 == Reaction(s) known to consume the compound ==
+* [[THIOREDOXIN-REDUCT-NADPH-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[LINOLENOYL-RXN]]
+* [[1.11.1.15-RXN]]
+* [[1.8.4.12-RXN]]
+* [[1.8.4.13-RXN]]
+* [[ADPREDUCT-RXN]]
+* [[CDPREDUCT-RXN]]
+* [[GDPREDUCT-RXN]]
+* [[MERCAPYSTRANS-RXN]]
+* [[RIBONUCLEOSIDE-DIP-REDUCTI-RXN]]
+* [[RXN-8668]]
+* [[RXN0-267]]
+* [[RXN0-5468]]
+* [[THIOREDOXIN-RXN]]
+* [[UDPREDUCT-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=&alpha;-linolenoyl-coa}}
+{{#set: common-name=an oxidized thioredoxin}}
-{{#set: molecular-weight=1023.921}}
-{{#set: inchi-key=inchikey=omkfkbgzhnjnex-kzwmewpfsa-j}}