Difference between revisions of "3-oxo-D5-steroids"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite COPROPORPHYRINOGEN_III == * common-name: ** coproporphyrinogen iii * molecular-weight: ** 656.734 * inchi-key: ** niuvhxtxuxofeb-uhfffaoy...") |
(Created page with "Category:metabolite == Metabolite 5-HYDROXYISOURATE == * common-name: ** (s)-5-hydroxyisourate * molecular-weight: ** 184.111 * inchi-key: ** ltqypavlayvktk-yfkpbyrvsa-n *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 5-HYDROXYISOURATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** (s)-5-hydroxyisourate |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 184.111 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ltqypavlayvktk-yfkpbyrvsa-n |
* smiles: | * smiles: | ||
| − | ** | + | ** c2(c1(o)(nc(=o)nc1=nc(=o)n2))(=o) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[3.5.2.17-RXN]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[URATE-OXIDASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(s)-5-hydroxyisourate}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=184.111}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ltqypavlayvktk-yfkpbyrvsa-n}} |
Revision as of 17:55, 13 January 2021
Contents
Metabolite 5-HYDROXYISOURATE
- common-name:
- (s)-5-hydroxyisourate
- molecular-weight:
- 184.111
- inchi-key:
- ltqypavlayvktk-yfkpbyrvsa-n
- smiles:
- c2(c1(o)(nc(=o)nc1=nc(=o)n2))(=o)
