Difference between revisions of "Glycols"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite METHYLAMINE == * common-name: ** methylamine * molecular-weight: ** 32.065 * inchi-key: ** bavyzaluxzfzlv-uhfffaoysa-o * smiles: ** c[n+]...") |
(Created page with "Category:metabolite == Metabolite CPD-497 == * common-name: ** pseudouridine * molecular-weight: ** 244.204 * inchi-key: ** ptjwiqphwpfnbw-gbndhiklsa-n * smiles: ** c1(nc(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-497 == |
* common-name: | * common-name: | ||
| − | ** | + | ** pseudouridine |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 244.204 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ptjwiqphwpfnbw-gbndhiklsa-n |
* smiles: | * smiles: | ||
| − | ** c | + | ** c1(nc(=o)nc(=o)c=1c2(oc(co)c(o)c(o)2)) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[PSEUDOURIDINE-KINASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=pseudouridine}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=244.204}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ptjwiqphwpfnbw-gbndhiklsa-n}} |
Revision as of 17:55, 13 January 2021
Contents
Metabolite CPD-497
- common-name:
- pseudouridine
- molecular-weight:
- 244.204
- inchi-key:
- ptjwiqphwpfnbw-gbndhiklsa-n
- smiles:
- c1(nc(=o)nc(=o)c=1c2(oc(co)c(o)c(o)2))
