Difference between revisions of "CPD-12443"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite QXC-ACP == * common_name: ** quinoxaline-2-carboxyl-[acyl-carrier protein] == Reaction(s) known to consume the compound == == Reaction(s)...") |
(Created page with "Category:metabolite == Metabolite ANTHRANILATE == * common-name: ** anthranilate * molecular-weight: ** 136.13 * inchi-key: ** rwzyaggxghygmb-uhfffaoysa-m * smiles: ** c(c...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite ANTHRANILATE == |
− | * | + | * common-name: |
− | ** | + | ** anthranilate |
+ | * molecular-weight: | ||
+ | ** 136.13 | ||
+ | * inchi-key: | ||
+ | ** rwzyaggxghygmb-uhfffaoysa-m | ||
+ | * smiles: | ||
+ | ** c(c1(c(=cc=cc=1)n))(=o)[o-] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[ANTHRANSYN-RXN]] | ||
+ | * [[PRTRANS-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[ANTHRANSYN-RXN]] |
+ | * [[PRTRANS-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: | + | {{#set: common-name=anthranilate}} |
+ | {{#set: molecular-weight=136.13}} | ||
+ | {{#set: inchi-key=inchikey=rwzyaggxghygmb-uhfffaoysa-m}} |
Revision as of 17:57, 13 January 2021
Contents
Metabolite ANTHRANILATE
- common-name:
- anthranilate
- molecular-weight:
- 136.13
- inchi-key:
- rwzyaggxghygmb-uhfffaoysa-m
- smiles:
- c(c1(c(=cc=cc=1)n))(=o)[o-]