Difference between revisions of "Acetoacetyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-1125 == * common-name: ** (r)-amygdalin * molecular-weight: ** 457.433 * inchi-key: ** xucijnaggsznqt-jhsldzjxsa-n * smiles: ** c3(c=...") |
(Created page with "Category:metabolite == Metabolite CPD-16819 == * common-name: ** 4-methylphenyl sulfate * molecular-weight: ** 187.19 * inchi-key: ** wgnakzgusrvwrh-uhfffaoysa-m * smiles:...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-16819 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-methylphenyl sulfate |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 187.19 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** wgnakzgusrvwrh-uhfffaoysa-m |
* smiles: | * smiles: | ||
| − | ** | + | ** cc1(c=cc(=cc=1)os(=o)(=o)[o-]) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-15588]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-methylphenyl sulfate}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=187.19}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wgnakzgusrvwrh-uhfffaoysa-m}} |
Revision as of 17:58, 13 January 2021
Contents
Metabolite CPD-16819
- common-name:
- 4-methylphenyl sulfate
- molecular-weight:
- 187.19
- inchi-key:
- wgnakzgusrvwrh-uhfffaoysa-m
- smiles:
- cc1(c=cc(=cc=1)os(=o)(=o)[o-])
