Difference between revisions of "Alcohols"

Revision as of 17:58, 13 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite D-MYO-INOSITOL-4-PHOSPHATE ==
+== Metabolite Alcohols ==
 * common-name:
-** 1d-myo-inositol 4-monophosphate
+** an alcohol
-* molecular-weight:
-** 258.121
-* inchi-key:
-** inapmgsxuvuwaf-cnwjwelysa-l
-* smiles:
-** c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1)
 == Reaction(s) known to consume the compound ==
-* [[RXN-10952]]
+* [[ALCOHOL-DEHYDROGENASE-NADP+-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[3.1.3.57-RXN]]
+* [[1.11.1.15-RXN]]
+* [[ACID-PHOSPHATASE-RXN]]
+* [[ALCOHOL-DEHYDROGENASE-NADP+-RXN]]
+* [[ALCOHOL-DEHYDROGENASE-NADPORNOP+-RXN]]
+* [[ALPHA-L-FUCOSIDASE-RXN]]
+* [[CARBOXYLESTERASE-RXN]]
+* [[GLYCPDIESTER-RXN]]
+* [[RXN-12615]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=1d-myo-inositol 4-monophosphate}}
+{{#set: common-name=an alcohol}}
-{{#set: molecular-weight=258.121}}
-{{#set: inchi-key=inchikey=inapmgsxuvuwaf-cnwjwelysa-l}}