Difference between revisions of "Serines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17866 == * common-name: ** s-sulfinatoglutathione * molecular-weight: ** 369.364 * inchi-key: ** qubutnszzfichl-wdskdsinsa-l * smiles...")
(Created page with "Category:metabolite == Metabolite Phospho-DNA-directed-RNA-polymerases == * common-name: ** phospho-[dna-directed rna-polymerase] == Reaction(s) known to consume the compo...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17866 ==
+
== Metabolite Phospho-DNA-directed-RNA-polymerases ==
 
* common-name:
 
* common-name:
** s-sulfinatoglutathione
+
** phospho-[dna-directed rna-polymerase]
* molecular-weight:
 
** 369.364
 
* inchi-key:
 
** qubutnszzfichl-wdskdsinsa-l
 
* smiles:
 
** c(ss([o-])=o)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16574]]
+
* [[RNA-POLYMERASE-SUBUNIT-KINASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[FESGSHTHIO-RXN]]
+
* [[RNA-POLYMERASE-SUBUNIT-KINASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=s-sulfinatoglutathione}}
+
{{#set: common-name=phospho-[dna-directed rna-polymerase]}}
{{#set: molecular-weight=369.364}}
 
{{#set: inchi-key=inchikey=qubutnszzfichl-wdskdsinsa-l}}
 

Revision as of 15:05, 15 March 2021

Metabolite Phospho-DNA-directed-RNA-polymerases

  • common-name:
    • phospho-[dna-directed rna-polymerase]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "phospho-[dna-directed rna-polymerase" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.