Difference between revisions of "1-PHOSPHATIDYL-1D-MYO-INOSITOL-34-BISPH"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CYSTINE == * common_name: ** l-cystine * smiles: ** c(c(c(=o)[o-])[n+])sscc(c([o-])=o)[n+] * inchi_key: ** inchikey=levwyrkdkasidu-imjsid...") |
(Created page with "Category:metabolite == Metabolite HEXANOYL-COA == * common-name: ** hexanoyl-coa * molecular-weight: ** 861.647 * inchi-key: ** oexfmsfodmqepe-hdrqghtbsa-j * smiles: ** cc...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite HEXANOYL-COA == |
− | * | + | * common-name: |
− | ** | + | ** hexanoyl-coa |
+ | * molecular-weight: | ||
+ | ** 861.647 | ||
+ | * inchi-key: | ||
+ | ** oexfmsfodmqepe-hdrqghtbsa-j | ||
* smiles: | * smiles: | ||
− | ** c(c(c(=o)[o-])[ | + | ** cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | + | * [[RXN-14278]] | |
− | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-14277]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: | + | {{#set: common-name=hexanoyl-coa}} |
− | {{#set: | + | {{#set: molecular-weight=861.647}} |
− | {{#set: | + | {{#set: inchi-key=inchikey=oexfmsfodmqepe-hdrqghtbsa-j}} |
Revision as of 15:05, 15 March 2021
Contents
Metabolite HEXANOYL-COA
- common-name:
- hexanoyl-coa
- molecular-weight:
- 861.647
- inchi-key:
- oexfmsfodmqepe-hdrqghtbsa-j
- smiles:
- cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]