Difference between revisions of "1-PHOSPHATIDYL-1D-MYO-INOSITOL-34-BISPH"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CYSTINE == * common_name: ** l-cystine * smiles: ** c(c(c(=o)[o-])[n+])sscc(c([o-])=o)[n+] * inchi_key: ** inchikey=levwyrkdkasidu-imjsid...")
(Created page with "Category:metabolite == Metabolite HEXANOYL-COA == * common-name: ** hexanoyl-coa * molecular-weight: ** 861.647 * inchi-key: ** oexfmsfodmqepe-hdrqghtbsa-j * smiles: ** cc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CYSTINE ==
+
== Metabolite HEXANOYL-COA ==
* common_name:
+
* common-name:
** l-cystine
+
** hexanoyl-coa
 +
* molecular-weight:
 +
** 861.647
 +
* inchi-key:
 +
** oexfmsfodmqepe-hdrqghtbsa-j
 
* smiles:
 
* smiles:
** c(c(c(=o)[o-])[n+])sscc(c([o-])=o)[n+]
+
** cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
* inchi_key:
 
** inchikey=levwyrkdkasidu-imjsidkusa-n
 
* molecular_weight:
 
** 240.292   
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[CYSTHIOCYS-RXN]]
+
* [[RXN-14278]]
* [[RXN-15128]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15128]]
+
* [[RXN-14277]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common_name=l-cystine}}
+
{{#set: common-name=hexanoyl-coa}}
{{#set: inchi_key=inchikey=levwyrkdkasidu-imjsidkusa-n}}
+
{{#set: molecular-weight=861.647}}
{{#set: molecular_weight=240.292    }}
+
{{#set: inchi-key=inchikey=oexfmsfodmqepe-hdrqghtbsa-j}}

Revision as of 15:05, 15 March 2021

Metabolite HEXANOYL-COA

  • common-name:
    • hexanoyl-coa
  • molecular-weight:
    • 861.647
  • inchi-key:
    • oexfmsfodmqepe-hdrqghtbsa-j
  • smiles:
    • cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality