Difference between revisions of "9Z-3-oxo-octadec-9-enoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-18550 == * common_name: ** quinoxaline-2-carboxyl adenylate * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(oc(=o)c4(c=...")
(Created page with "Category:metabolite == Metabolite Lipoyl-Protein-L-Lysine == * common-name: ** a [lipoyl-carrier protein]-l-lysine == Reaction(s) known to consume the compound == * RXN0...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-18550 ==
+
== Metabolite Lipoyl-Protein-L-Lysine ==
* common_name:
+
* common-name:
** quinoxaline-2-carboxyl adenylate
+
** a [lipoyl-carrier protein]-l-lysine
* smiles:
 
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(oc(=o)c4(c=nc5(=cc=cc=c(n=4)5)))([o-])=o
 
* inchi_key:
 
** inchikey=vmjweicpcdrxql-scfuhwhpsa-m
 
* molecular_weight:
 
** 502.359   
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17155]]
+
* [[RXN0-947]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common_name=quinoxaline-2-carboxyl adenylate}}
+
{{#set: common-name=a [lipoyl-carrier protein]-l-lysine}}
{{#set: inchi_key=inchikey=vmjweicpcdrxql-scfuhwhpsa-m}}
 
{{#set: molecular_weight=502.359    }}
 

Revision as of 15:07, 15 March 2021

Metabolite Lipoyl-Protein-L-Lysine

  • common-name:
    • a [lipoyl-carrier protein]-l-lysine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [lipoyl-carrier protein]-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.