Difference between revisions of "Microtubules"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite RIBULOSE-5P == * common-name: ** d-ribulose 5-phosphate * molecular-weight: ** 228.095 * inchi-key: ** fnzlkvnuwiipsj-uhnvwzdzsa-l * smil...") |
(Created page with "Category:metabolite == Metabolite CPD-11876 == * common-name: ** 3-methoxy-4-hydroxyphenylglycolaldehyde * molecular-weight: ** 182.176 * inchi-key: ** visajvapypfkcl-qmmm...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-11876 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-methoxy-4-hydroxyphenylglycolaldehyde |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 182.176 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** visajvapypfkcl-qmmmgpobsa-n |
* smiles: | * smiles: | ||
| − | ** | + | ** coc1(=c(o)c=cc(c(o)c=o)=c1) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-10917]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-methoxy-4-hydroxyphenylglycolaldehyde}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=182.176}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=visajvapypfkcl-qmmmgpobsa-n}} |
Revision as of 15:08, 15 March 2021
Contents
Metabolite CPD-11876
- common-name:
- 3-methoxy-4-hydroxyphenylglycolaldehyde
- molecular-weight:
- 182.176
- inchi-key:
- visajvapypfkcl-qmmmgpobsa-n
- smiles:
- coc1(=c(o)c=cc(c(o)c=o)=c1)
