Difference between revisions of "CPD-12443"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ANTHRANILATE == * common-name: ** anthranilate * molecular-weight: ** 136.13 * inchi-key: ** rwzyaggxghygmb-uhfffaoysa-m * smiles: ** c(c...") |
(Created page with "Category:metabolite == Metabolite P-HYDROXY-PHENYLPYRUVATE == * common-name: ** 3-(4-hydroxyphenyl)pyruvate * molecular-weight: ** 179.152 * inchi-key: ** kkadpxvioxhvkn-u...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite P-HYDROXY-PHENYLPYRUVATE == |
* common-name: | * common-name: | ||
− | ** | + | ** 3-(4-hydroxyphenyl)pyruvate |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 179.152 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** kkadpxvioxhvkn-uhfffaoysa-m |
* smiles: | * smiles: | ||
− | ** c( | + | ** c1(c(cc(c([o-])=o)=o)=cc=c(c=1)o) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[4-HYDROXYPHENYLPYRUVATE-DIOXYGENASE-RXN]] |
− | * [[ | + | * [[RXN3O-4157]] |
+ | * [[TYROSINE-AMINOTRANSFERASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[PREPHENATE-DEHYDROGENASE-NADP+-RXN]] |
− | * [[ | + | * [[PREPHENATEDEHYDROG-RXN]] |
+ | * [[RXN3O-4157]] | ||
+ | * [[TYROSINE-AMINOTRANSFERASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3-(4-hydroxyphenyl)pyruvate}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=179.152}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=kkadpxvioxhvkn-uhfffaoysa-m}} |
Revision as of 15:12, 15 March 2021
Contents
Metabolite P-HYDROXY-PHENYLPYRUVATE
- common-name:
- 3-(4-hydroxyphenyl)pyruvate
- molecular-weight:
- 179.152
- inchi-key:
- kkadpxvioxhvkn-uhfffaoysa-m
- smiles:
- c1(c(cc(c([o-])=o)=o)=cc=c(c=1)o)