Difference between revisions of "CPD-12443"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ANTHRANILATE == * common-name: ** anthranilate * molecular-weight: ** 136.13 * inchi-key: ** rwzyaggxghygmb-uhfffaoysa-m * smiles: ** c(c...")
(Created page with "Category:metabolite == Metabolite P-HYDROXY-PHENYLPYRUVATE == * common-name: ** 3-(4-hydroxyphenyl)pyruvate * molecular-weight: ** 179.152 * inchi-key: ** kkadpxvioxhvkn-u...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ANTHRANILATE ==
+
== Metabolite P-HYDROXY-PHENYLPYRUVATE ==
 
* common-name:
 
* common-name:
** anthranilate
+
** 3-(4-hydroxyphenyl)pyruvate
 
* molecular-weight:
 
* molecular-weight:
** 136.13
+
** 179.152
 
* inchi-key:
 
* inchi-key:
** rwzyaggxghygmb-uhfffaoysa-m
+
** kkadpxvioxhvkn-uhfffaoysa-m
 
* smiles:
 
* smiles:
** c(c1(c(=cc=cc=1)n))(=o)[o-]
+
** c1(c(cc(c([o-])=o)=o)=cc=c(c=1)o)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ANTHRANSYN-RXN]]
+
* [[4-HYDROXYPHENYLPYRUVATE-DIOXYGENASE-RXN]]
* [[PRTRANS-RXN]]
+
* [[RXN3O-4157]]
 +
* [[TYROSINE-AMINOTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ANTHRANSYN-RXN]]
+
* [[PREPHENATE-DEHYDROGENASE-NADP+-RXN]]
* [[PRTRANS-RXN]]
+
* [[PREPHENATEDEHYDROG-RXN]]
 +
* [[RXN3O-4157]]
 +
* [[TYROSINE-AMINOTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=anthranilate}}
+
{{#set: common-name=3-(4-hydroxyphenyl)pyruvate}}
{{#set: molecular-weight=136.13}}
+
{{#set: molecular-weight=179.152}}
{{#set: inchi-key=inchikey=rwzyaggxghygmb-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=kkadpxvioxhvkn-uhfffaoysa-m}}

Revision as of 15:12, 15 March 2021

Metabolite P-HYDROXY-PHENYLPYRUVATE

  • common-name:
    • 3-(4-hydroxyphenyl)pyruvate
  • molecular-weight:
    • 179.152
  • inchi-key:
    • kkadpxvioxhvkn-uhfffaoysa-m
  • smiles:
    • c1(c(cc(c([o-])=o)=o)=cc=c(c=1)o)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality