Difference between revisions of "1-PHOSPHATIDYL-1D-MYO-INOSITOL-34-BISPH"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite HEXANOYL-COA == * common-name: ** hexanoyl-coa * molecular-weight: ** 861.647 * inchi-key: ** oexfmsfodmqepe-hdrqghtbsa-j * smiles: ** cc...")
(Created page with "Category:metabolite == Metabolite HYDROGEN-PEROXIDE == * common-name: ** hydrogen peroxide * molecular-weight: ** 34.015 * inchi-key: ** mhajpdpjqmaiiy-uhfffaoysa-n * smil...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite HEXANOYL-COA ==
+
== Metabolite HYDROGEN-PEROXIDE ==
 
* common-name:
 
* common-name:
−
** hexanoyl-coa
+
** hydrogen peroxide
 
* molecular-weight:
 
* molecular-weight:
−
** 861.647
+
** 34.015
 
* inchi-key:
 
* inchi-key:
−
** oexfmsfodmqepe-hdrqghtbsa-j
+
** mhajpdpjqmaiiy-uhfffaoysa-n
 
* smiles:
 
* smiles:
−
** cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** oo
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-14278]]
+
* [[CATAL-RXN]]
 +
* [[CHLORIDE-PEROXIDASE-RXN]]
 +
* [[ExchangeSeed-HYDROGEN-PEROXIDE]]
 +
* [[GLUTATHIONE-PEROXIDASE-RXN]]
 +
* [[PEROXID-RXN]]
 +
* [[RXN-11329]]
 +
* [[RXN-12440]]
 +
* [[RXN-12540]]
 +
* [[RXN-14189]]
 +
* [[RXN-14240]]
 +
* [[RXN-15288]]
 +
* [[RXN-17352]]
 +
* [[RXN-3521]]
 +
* [[RXN-8243]]
 +
* [[RXN-8635]]
 +
* [[RXN-8667]]
 +
* [[RXN0-267]]
 +
* [[RXN66-1]]
 +
* [[TransportSeed-HYDROGEN-PEROXIDE]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-14277]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[1.1.3.37-RXN]]
 +
* [[ACYL-COA-OXIDASE-RXN]]
 +
* [[AMACETOXID-RXN]]
 +
* [[AMINEOXID-RXN]]
 +
* [[AMINEPHEN-RXN]]
 +
* [[ARG-OXIDATION-RXN]]
 +
* [[ExchangeSeed-HYDROGEN-PEROXIDE]]
 +
* [[GLYOXYLATE-OXIDASE-RXN]]
 +
* [[L-AMINO-ACID-OXIDASE-RXN]]
 +
* [[L-ASPARTATE-OXID-RXN]]
 +
* [[L-LYSINE-OXIDASE-RXN]]
 +
* [[OXALATE-OXIDASE-RXN]]
 +
* [[PMPOXI-RXN]]
 +
* [[PNPOXI-RXN]]
 +
* [[POLYAMINE-OXIDASE-RXN]]
 +
* [[PROTOPORGENOXI-RXN]]
 +
* [[RXN-10460]]
 +
* [[RXN-10696]]
 +
* [[RXN-10706]]
 +
* [[RXN-10707]]
 +
* [[RXN-11026]]
 +
* [[RXN-11519]]
 +
* [[RXN-11520]]
 +
* [[RXN-11521]]
 +
* [[RXN-11784]]
 +
* [[RXN-12089]]
 +
* [[RXN-12090]]
 +
* [[RXN-12091]]
 +
* [[RXN-12518]]
 +
* [[RXN-12669]]
 +
* [[RXN-14576]]
 +
* [[RXN-14771]]
 +
* [[RXN-14775]]
 +
* [[RXN-14785]]
 +
* [[RXN-14789]]
 +
* [[RXN-14796]]
 +
* [[RXN-15684]]
 +
* [[RXN-16134]]
 +
* [[RXN-17113]]
 +
* [[RXN-17130]]
 +
* [[RXN-5821]]
 +
* [[RXN-6381]]
 +
* [[RXN-8244]]
 +
* [[RXN-9015]]
 +
* [[RXN-9597]]
 +
* [[RXN-9599]]
 +
* [[RXN-9600]]
 +
* [[RXN-969]]
 +
* [[RXN-9940]]
 +
* [[RXN6666-4]]
 +
* [[S-2-HYDROXY-ACID-OXIDASE-RXN]]
 +
* [[SULFITE-OXIDASE-RXN]]
 +
* [[SUPEROX-DISMUT-RXN]]
 +
* [[THIOL-OXIDASE-RXN]]
 +
* [[TransportSeed-HYDROGEN-PEROXIDE]]
 +
* [[URATE-OXIDASE-RXN]]
 +
* [[XANTHINE-OXIDASE-RXN]]
 +
</div>
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=hexanoyl-coa}}
+
{{#set: common-name=hydrogen peroxide}}
−
{{#set: molecular-weight=861.647}}
+
{{#set: molecular-weight=34.015}}
−
{{#set: inchi-key=inchikey=oexfmsfodmqepe-hdrqghtbsa-j}}
+
{{#set: inchi-key=inchikey=mhajpdpjqmaiiy-uhfffaoysa-n}}

Revision as of 18:59, 17 March 2021

Metabolite HYDROGEN-PEROXIDE

  • common-name:
    • hydrogen peroxide
  • molecular-weight:
    • 34.015
  • inchi-key:
    • mhajpdpjqmaiiy-uhfffaoysa-n
  • smiles:
    • oo

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=1-PHOSPHATIDYL-1D-MYO-INOSITOL-34-BISPH&oldid=37983"