Difference between revisions of "I-antigens"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite i-Antigens == * common-name: ** an i antigen == Reaction(s) known to consume the compound == * RXN-15277 == Reaction(s) known to prod...") |
(Created page with "Category:metabolite == Metabolite CPD-499 == * common-name: ** (r)-5-phosphomevalonate * molecular-weight: ** 225.115 * inchi-key: ** okzycxhttzzysk-zcfiwibfsa-k * smiles:...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-499 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (r)-5-phosphomevalonate |
| + | * molecular-weight: | ||
| + | ** 225.115 | ||
| + | * inchi-key: | ||
| + | ** okzycxhttzzysk-zcfiwibfsa-k | ||
| + | * smiles: | ||
| + | ** cc(o)(ccop(=o)([o-])[o-])cc(=o)[o-] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[MEVALONATE-KINASE-RXN]] |
| + | * [[PHOSPHOMEVALONATE-KINASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[MEVALONATE-KINASE-RXN]] |
| + | * [[PHOSPHOMEVALONATE-KINASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(r)-5-phosphomevalonate}} |
| + | {{#set: molecular-weight=225.115}} | ||
| + | {{#set: inchi-key=inchikey=okzycxhttzzysk-zcfiwibfsa-k}} | ||
Revision as of 19:00, 17 March 2021
Contents
Metabolite CPD-499
- common-name:
- (r)-5-phosphomevalonate
- molecular-weight:
- 225.115
- inchi-key:
- okzycxhttzzysk-zcfiwibfsa-k
- smiles:
- cc(o)(ccop(=o)([o-])[o-])cc(=o)[o-]
