Difference between revisions of "ALGINATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite L-SELENOCYSTEINE == * common-name: ** l-selenocysteine * molecular-weight: ** 168.054 * inchi-key: ** zkzbpngneqajsx-reohclbhsa-n * smile...")
(Created page with "Category:metabolite == Metabolite CPD-11525 == * common-name: ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-coa * molecular-weight: ** 983.813 * inchi-key: ** yyuzy...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite L-SELENOCYSTEINE ==
+
== Metabolite CPD-11525 ==
 
* common-name:
 
* common-name:
** l-selenocysteine
+
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-coa
 
* molecular-weight:
 
* molecular-weight:
** 168.054
+
** 983.813
 
* inchi-key:
 
* inchi-key:
** zkzbpngneqajsx-reohclbhsa-n
+
** yyuzysvpfvoylb-rguwmiccsa-j
 
* smiles:
 
* smiles:
** c([se])c([n+])c([o-])=o
+
** ccc=ccc1(c(ccc(=o)1)cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[SELENOCYSTEINE-LYASE-RXN]]
+
* [[RXN-10707]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12726]]
+
* [[RXN-10700]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-selenocysteine}}
+
{{#set: common-name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-coa}}
{{#set: molecular-weight=168.054}}
+
{{#set: molecular-weight=983.813}}
{{#set: inchi-key=inchikey=zkzbpngneqajsx-reohclbhsa-n}}
+
{{#set: inchi-key=inchikey=yyuzysvpfvoylb-rguwmiccsa-j}}

Revision as of 19:01, 17 March 2021

Metabolite CPD-11525

  • common-name:
    • 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-butanoyl-coa
  • molecular-weight:
    • 983.813
  • inchi-key:
    • yyuzysvpfvoylb-rguwmiccsa-j
  • smiles:
    • ccc=ccc1(c(ccc(=o)1)cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-])

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality