Difference between revisions of "2-Hexadecenoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite D-XYLULOSE == * common-name: ** d-xylulose * molecular-weight: ** 150.131 * inchi-key: ** zaqjhhrnxzubte-wujlrwpwsa-n * smiles: ** c(o)c(...") |
(Created page with "Category:metabolite == Metabolite N1-ACETYLSPERMINE == * common-name: ** n1-acetylspermine * molecular-weight: ** 247.403 * inchi-key: ** gunurvwajrruav-uhfffaoysa-q * smi...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite N1-ACETYLSPERMINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** n1-acetylspermine |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 247.403 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** gunurvwajrruav-uhfffaoysa-q |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(=o)nccc[n+]cccc[n+]ccc[n+] |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[POLYAMINE-OXIDASE-RXN]] |
| + | * [[RXN-12090]] | ||
| + | * [[RXN-9940]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n1-acetylspermine}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=247.403}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=gunurvwajrruav-uhfffaoysa-q}} |
Revision as of 19:01, 17 March 2021
Contents
Metabolite N1-ACETYLSPERMINE
- common-name:
- n1-acetylspermine
- molecular-weight:
- 247.403
- inchi-key:
- gunurvwajrruav-uhfffaoysa-q
- smiles:
- cc(=o)nccc[n+]cccc[n+]ccc[n+]
