Difference between revisions of "FRU1P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13914 == * common-name: ** cyclic-2,3-o-oxalyl-l-threonate * molecular-weight: ** 189.101 * inchi-key: ** nkbsfrftbuhmjf-uhfffaoysa-m...")
(Created page with "Category:metabolite == Metabolite 34-DIHYDROXYPHENYLACETALDEHYDE == * common-name: ** 3,4-dihydroxyphenylacetaldehyde * molecular-weight: ** 152.149 * inchi-key: ** iadqvx...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13914 ==
+
== Metabolite 34-DIHYDROXYPHENYLACETALDEHYDE ==
 
* common-name:
 
* common-name:
** cyclic-2,3-o-oxalyl-l-threonate
+
** 3,4-dihydroxyphenylacetaldehyde
 
* molecular-weight:
 
* molecular-weight:
** 189.101
+
** 152.149
 
* inchi-key:
 
* inchi-key:
** nkbsfrftbuhmjf-uhfffaoysa-m
+
** iadqvxrmsniuel-uhfffaoysa-n
 
* smiles:
 
* smiles:
** c(o)c1(oc(=o)c(=o)oc(c(=o)[o-])1)
+
** c1(=cc(=c(o)c=c1c[ch]=o)o)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12872]]
+
* [[RXN6666-5]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12869]]
+
* [[RXN6666-4]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=cyclic-2,3-o-oxalyl-l-threonate}}
+
{{#set: common-name=3,4-dihydroxyphenylacetaldehyde}}
{{#set: molecular-weight=189.101}}
+
{{#set: molecular-weight=152.149}}
{{#set: inchi-key=inchikey=nkbsfrftbuhmjf-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=iadqvxrmsniuel-uhfffaoysa-n}}

Revision as of 19:02, 17 March 2021

Metabolite 34-DIHYDROXYPHENYLACETALDEHYDE

  • common-name:
    • 3,4-dihydroxyphenylacetaldehyde
  • molecular-weight:
    • 152.149
  • inchi-key:
    • iadqvxrmsniuel-uhfffaoysa-n
  • smiles:
    • c1(=cc(=c(o)c=c1c[ch]=o)o)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality