Difference between revisions of "Diamines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite TRANS-D2-ENOYL-COA == * common-name: ** a trans-2-enoyl-coa == Reaction(s) known to consume the compound == * ENOYL-COA-HYDRAT-RXN *...") |
(Created page with "Category:metabolite == Metabolite CPD-15924 == * common_name: ** 1-oleoyl-2-lyso-glycerone phosphate * smiles: ** ccccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)=o * inchi_k...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-15924 == |
| − | * | + | * common_name: |
| − | ** | + | ** 1-oleoyl-2-lyso-glycerone phosphate |
| + | * smiles: | ||
| + | ** ccccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)=o | ||
| + | * inchi_key: | ||
| + | ** inchikey=yzkfnnqaebncen-ktkrtigzsa-l | ||
| + | * molecular_weight: | ||
| + | ** 432.493 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-15046]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-15044]] | |
| − | |||
| − | |||
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: | + | {{#set: common_name=1-oleoyl-2-lyso-glycerone phosphate}} |
| + | {{#set: inchi_key=inchikey=yzkfnnqaebncen-ktkrtigzsa-l}} | ||
| + | {{#set: molecular_weight=432.493 }} | ||
Revision as of 19:02, 17 March 2021
Contents
Metabolite CPD-15924
- common_name:
- 1-oleoyl-2-lyso-glycerone phosphate
- smiles:
- ccccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)=o
- inchi_key:
- inchikey=yzkfnnqaebncen-ktkrtigzsa-l
- molecular_weight:
- 432.493
