Difference between revisions of "Thiocarboxylated-MPT-synthases"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite cis-D21-39-oxo-40-Me-C59-1-ACPs == * common-name: ** a cis-delta21-39-oxo-40-methyl-c59:1-[acp] == Reaction(s) known to consume the compo...") |
(Created page with "Category:metabolite == Metabolite CPD-7087 == * common-name: ** (+)-dihydromyricetin * molecular-weight: ** 319.247 * inchi-key: ** kjxsixmjhkajod-lsdhhaiusa-m * smiles: *...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-7087 == |
* common-name: | * common-name: | ||
− | ** | + | ** (+)-dihydromyricetin |
+ | * molecular-weight: | ||
+ | ** 319.247 | ||
+ | * inchi-key: | ||
+ | ** kjxsixmjhkajod-lsdhhaiusa-m | ||
+ | * smiles: | ||
+ | ** c3(c(c2(oc1(c=c(c=c(c=1c(c2o)=o)o)[o-])))=cc(=c(c=3o)o)o) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-7784]] |
+ | * [[RXN-8450]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-7922]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(+)-dihydromyricetin}} |
+ | {{#set: molecular-weight=319.247}} | ||
+ | {{#set: inchi-key=inchikey=kjxsixmjhkajod-lsdhhaiusa-m}} |
Revision as of 19:03, 17 March 2021
Contents
Metabolite CPD-7087
- common-name:
- (+)-dihydromyricetin
- molecular-weight:
- 319.247
- inchi-key:
- kjxsixmjhkajod-lsdhhaiusa-m
- smiles:
- c3(c(c2(oc1(c=c(c=c(c=1c(c2o)=o)o)[o-])))=cc(=c(c=3o)o)o)