Difference between revisions of "1-PHOSPHATIDYL-1D-MYO-INOSITOL-5-PHOSPHA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12902 == * common-name: ** 5-methylhex-4-enoyl-coa * molecular-weight: ** 873.658 * inchi-key: ** beyylhumfmwplh-svhodsnwsa-j * smile...") |
(Created page with "Category:metabolite == Metabolite CPD-14925 == * common-name: ** (3z)-dec-3-enoyl-coa * molecular-weight: ** 915.738 * inchi-key: ** cqgvnmqhzqjnii-uusbzyposa-j * smiles:...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-14925 == |
* common-name: | * common-name: | ||
− | ** | + | ** (3z)-dec-3-enoyl-coa |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 915.738 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** cqgvnmqhzqjnii-uusbzyposa-j |
* smiles: | * smiles: | ||
− | ** | + | ** ccccccc=ccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-17799]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(3z)-dec-3-enoyl-coa}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=915.738}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=cqgvnmqhzqjnii-uusbzyposa-j}} |
Revision as of 19:03, 17 March 2021
Contents
Metabolite CPD-14925
- common-name:
- (3z)-dec-3-enoyl-coa
- molecular-weight:
- 915.738
- inchi-key:
- cqgvnmqhzqjnii-uusbzyposa-j
- smiles:
- ccccccc=ccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o