Difference between revisions of "1-PHOSPHATIDYL-1D-MYO-INOSITOL-5-PHOSPHA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12902 == * common-name: ** 5-methylhex-4-enoyl-coa * molecular-weight: ** 873.658 * inchi-key: ** beyylhumfmwplh-svhodsnwsa-j * smile...")
(Created page with "Category:metabolite == Metabolite CPD-14925 == * common-name: ** (3z)-dec-3-enoyl-coa * molecular-weight: ** 915.738 * inchi-key: ** cqgvnmqhzqjnii-uusbzyposa-j * smiles:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12902 ==
+
== Metabolite CPD-14925 ==
 
* common-name:
 
* common-name:
** 5-methylhex-4-enoyl-coa
+
** (3z)-dec-3-enoyl-coa
 
* molecular-weight:
 
* molecular-weight:
** 873.658
+
** 915.738
 
* inchi-key:
 
* inchi-key:
** beyylhumfmwplh-svhodsnwsa-j
+
** cqgvnmqhzqjnii-uusbzyposa-j
 
* smiles:
 
* smiles:
** cc(c)=cccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** ccccccc=ccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11917]]
+
* [[RXN-17799]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=5-methylhex-4-enoyl-coa}}
+
{{#set: common-name=(3z)-dec-3-enoyl-coa}}
{{#set: molecular-weight=873.658}}
+
{{#set: molecular-weight=915.738}}
{{#set: inchi-key=inchikey=beyylhumfmwplh-svhodsnwsa-j}}
+
{{#set: inchi-key=inchikey=cqgvnmqhzqjnii-uusbzyposa-j}}

Revision as of 19:03, 17 March 2021

Metabolite CPD-14925

  • common-name:
    • (3z)-dec-3-enoyl-coa
  • molecular-weight:
    • 915.738
  • inchi-key:
    • cqgvnmqhzqjnii-uusbzyposa-j
  • smiles:
    • ccccccc=ccc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality