Difference between revisions of "Acetoacetyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 4-AMINO-4-DEOXYCHORISMATE == * common-name: ** 4-amino-4-deoxychorismate * molecular-weight: ** 224.193 * inchi-key: ** oiujhgolfkdbsu-ht...") |
(Created page with "Category:metabolite == Metabolite CPD-16819 == * common-name: ** 4-methylphenyl sulfate * molecular-weight: ** 187.19 * inchi-key: ** wgnakzgusrvwrh-uhfffaoysa-m * smiles:...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-16819 == |
* common-name: | * common-name: | ||
− | ** 4- | + | ** 4-methylphenyl sulfate |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 187.19 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** wgnakzgusrvwrh-uhfffaoysa-m |
* smiles: | * smiles: | ||
− | ** c= | + | ** cc1(c=cc(=cc=1)os(=o)(=o)[o-]) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-15588]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=4- | + | {{#set: common-name=4-methylphenyl sulfate}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=187.19}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wgnakzgusrvwrh-uhfffaoysa-m}} |
Revision as of 19:03, 17 March 2021
Contents
Metabolite CPD-16819
- common-name:
- 4-methylphenyl sulfate
- molecular-weight:
- 187.19
- inchi-key:
- wgnakzgusrvwrh-uhfffaoysa-m
- smiles:
- cc1(c=cc(=cc=1)os(=o)(=o)[o-])