Difference between revisions of "Diamines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15924 == * common_name: ** 1-oleoyl-2-lyso-glycerone phosphate * smiles: ** ccccccccc=ccccccccc(=o)occ(cop([o-])([o-])=o)=o * inchi_k...") |
(Created page with "Category:metabolite == Metabolite Diamines == * common-name: ** a diamine == Reaction(s) known to consume the compound == * RXN-9599 == Reaction(s) known to produce th...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Diamines == |
| − | * | + | * common-name: |
| − | + | ** a diamine | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | ** | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-9599]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: | + | {{#set: common-name=a diamine}} |
| − | |||
| − | |||
Latest revision as of 19:35, 17 March 2021
Contents
Metabolite Diamines
- common-name:
- a diamine
