Difference between revisions of "Thiocarboxylated-MPT-synthases"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7087 == * common-name: ** (+)-dihydromyricetin * molecular-weight: ** 319.247 * inchi-key: ** kjxsixmjhkajod-lsdhhaiusa-m * smiles: *...")
(Created page with "Category:metabolite == Metabolite Thiocarboxylated-MPT-synthases == * common-name: ** a thiocarboxylated [small subunit of molybdopterin synthase] == Reaction(s) known to...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7087 ==
+
== Metabolite Thiocarboxylated-MPT-synthases ==
 
* common-name:
 
* common-name:
** (+)-dihydromyricetin
+
** a thiocarboxylated [small subunit of molybdopterin synthase]
* molecular-weight:
 
** 319.247
 
* inchi-key:
 
** kjxsixmjhkajod-lsdhhaiusa-m
 
* smiles:
 
** c3(c(c2(oc1(c=c(c=c(c=1c(c2o)=o)o)[o-])))=cc(=c(c=3o)o)o)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7784]]
+
* [[RXN-8342]]
* [[RXN-8450]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7922]]
+
* [[RXN-12473]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(+)-dihydromyricetin}}
+
{{#set: common-name=a thiocarboxylated [small subunit of molybdopterin synthase]}}
{{#set: molecular-weight=319.247}}
 
{{#set: inchi-key=inchikey=kjxsixmjhkajod-lsdhhaiusa-m}}
 

Latest revision as of 19:36, 17 March 2021

Metabolite Thiocarboxylated-MPT-synthases

  • common-name:
    • a thiocarboxylated [small subunit of molybdopterin synthase]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a thiocarboxylated [small subunit of molybdopterin synthase" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.