MediaWiki API result
This is the HTML representation of the JSON format. HTML is good for debugging, but is unsuitable for application use.
Specify the format parameter to change the output format. To see the non-HTML representation of the JSON format, set format=json.
See the complete documentation, or the API help for more information.
{ "batchcomplete": "", "continue": { "arvcontinue": "20191014153851|52", "continue": "-||" }, "query": { "allrevisions": [ { "pageid": 1, "revisions": [ { "revid": 1, "parentid": 0, "user": "MediaWiki default", "anon": "", "timestamp": "2019-10-14T14:31:51Z", "comment": "" } ], "ns": 0, "title": "Main Page" }, { "pageid": 2, "revisions": [ { "revid": 3, "parentid": 0, "user": "127.0.0.1", "anon": "", "timestamp": "2019-10-14T14:32:09Z", "comment": "Semantic MediaWiki default vocabulary import" } ], "ns": 8, "title": "MediaWiki:Smw import skos" }, { "pageid": 3, "revisions": [ { "revid": 4, "parentid": 0, "user": "127.0.0.1", "anon": "", "timestamp": "2019-10-14T14:32:09Z", "comment": "Semantic MediaWiki default vocabulary import" } ], "ns": 8, "title": "MediaWiki:Smw import foaf" }, { "pageid": 4, "revisions": [ { "revid": 5, "parentid": 0, "user": "127.0.0.1", "anon": "", "timestamp": "2019-10-14T14:32:10Z", "comment": "Semantic MediaWiki default vocabulary import" } ], "ns": 8, "title": "MediaWiki:Smw import owl" }, { "pageid": 5, "revisions": [ { "revid": 6, "parentid": 0, "user": "127.0.0.1", "anon": "", "timestamp": "2019-10-14T14:32:10Z", "comment": "Semantic MediaWiki default vocabulary import" } ], "ns": 102, "title": "Property:Foaf:knows" }, { "pageid": 6, "revisions": [ { "revid": 7, "parentid": 0, "user": "127.0.0.1", "anon": "", "timestamp": "2019-10-14T14:32:10Z", "comment": "Semantic MediaWiki default vocabulary import" } ], "ns": 102, "title": "Property:Foaf:name" }, { "pageid": 7, "revisions": [ { "revid": 8, "parentid": 0, "user": "127.0.0.1", "anon": "", "timestamp": "2019-10-14T14:32:10Z", "comment": "Semantic MediaWiki default vocabulary import" } ], "ns": 102, "title": "Property:Foaf:homepage" }, { "pageid": 8, "revisions": [ { "revid": 9, "parentid": 0, "user": "127.0.0.1", "anon": "", "timestamp": "2019-10-14T14:32:10Z", "comment": "Semantic MediaWiki default vocabulary import" } ], "ns": 102, "title": "Property:Owl:differentFrom" }, { "pageid": 9, "revisions": [ { "revid": 10, "parentid": 0, "user": "Maintenance script", "timestamp": "2019-10-14T14:32:11Z", "comment": "" } ], "ns": 6, "title": "File:Reaction creator.csv" }, { "pageid": 10, "revisions": [ { "revid": 11, "parentid": 0, "user": "Maintenance script", "timestamp": "2019-10-14T14:32:11Z", "comment": "" } ], "ns": 6, "title": "File:Add delete reaction.csv" }, { "pageid": 11, "revisions": [ { "revid": 12, "parentid": 0, "user": "Bot 15", "timestamp": "2019-10-14T15:38:50Z", "comment": "Created page with \"{{#ask: [[Category:Reaction]] [[reconstruction tool::pathwaytools]] | ?COMMON NAME | ?ec number | ?reconstruction category | ?reconstruction tool | ?reconstruction source | ?r...\"" } ], "ns": 0, "title": "Pathwaytools" }, { "pageid": 12, "revisions": [ { "revid": 13, "parentid": 0, "user": "Bot 20", "timestamp": "2019-10-14T15:38:50Z", "comment": "Created page with \"{{#ask: [[Category:Reaction]] [[reconstruction tool::meneco]] | ?COMMON NAME | ?ec number | ?reconstruction category | ?reconstruction tool | ?reconstruction source | ?reconst...\"" } ], "ns": 0, "title": "Meneco" }, { "pageid": 13, "revisions": [ { "revid": 14, "parentid": 0, "user": "Bot 19", "timestamp": "2019-10-14T15:38:50Z", "comment": "Created page with \"{{#ask: [[Category:Reaction]] [[reconstruction category::manual]] | ?common name | ?ec number | ?reconstruction category | ?reconstruction tool | ?reconstruction source | ?rec...\"" } ], "ns": 0, "title": "Manual" }, { "pageid": 14, "revisions": [ { "revid": 15, "parentid": 0, "user": "Bot 16", "timestamp": "2019-10-14T15:38:50Z", "comment": "Created page with \"{{#ask: [[Category:Metabolite]] | ?common name | ?consumed by | ?produced by | ?reversible reaction associated }}\"" } ], "ns": 14, "title": "Category:Metabolite" }, { "pageid": 15, "revisions": [ { "revid": 16, "parentid": 0, "user": "Bot 14", "timestamp": "2019-10-14T15:38:50Z", "comment": "Created page with \"{{#ask: [[Category:Reaction]] [[reconstruction source::manual-reactions_to_add]] | ?COMMON NAME | ?ec number | ?reconstruction category | ?reconstruction tool | ?reconstructio...\"" } ], "ns": 0, "title": "Manual-reactions to add" }, { "pageid": 17, "revisions": [ { "revid": 17, "parentid": 0, "user": "Bot 26", "timestamp": "2019-10-14T15:38:50Z", "comment": "Created page with \"{{#ask: [[Category:Reaction]] [[reconstruction category::gap-filling]] | ?common name | ?ec number | ?reconstruction category | ?reconstruction tool | ?reconstruction source |...\"" } ], "ns": 0, "title": "Gap-filling" }, { "pageid": 18, "revisions": [ { "revid": 18, "parentid": 0, "user": "Bot 24", "timestamp": "2019-10-14T15:38:50Z", "comment": "Created page with \"{{#ask: [[Category:Reaction]] [[reconstruction tool::pantograph]] | ?COMMON NAME | ?ec number | ?reconstruction category | ?reconstruction tool | ?reconstruction source | ?rec...\"" } ], "ns": 0, "title": "Pantograph" }, { "pageid": 19, "revisions": [ { "revid": 19, "parentid": 0, "user": "Bot 1", "timestamp": "2019-10-14T15:38:50Z", "comment": "Created page with \"{{#ask: [[Category:Reaction]] [[reconstruction source::annotation-original_genome]] | ?COMMON NAME | ?ec number | ?reconstruction category | ?reconstruction tool | ?reconstruc...\"" } ], "ns": 0, "title": "Annotation-original genome" }, { "pageid": 16, "revisions": [ { "revid": 20, "parentid": 0, "user": "Bot 17", "timestamp": "2019-10-14T15:38:50Z", "comment": "Created page with \"{{#ask: [[Category:Reaction]] [[reconstruction source::gap-filling-gapfilling_solution_with_meneco_draft_medium]] | ?COMMON NAME | ?ec number | ?reconstruction category | ?rec...\"" } ], "ns": 0, "title": "Gap-filling-gapfilling solution with meneco draft medium" }, { "pageid": 20, "revisions": [ { "revid": 21, "parentid": 0, "user": "Bot 4", "timestamp": "2019-10-14T15:38:50Z", "comment": "Created page with \"{{#ask: [[Category:Reaction]] [[reconstruction source::manual-biomass_reaction]] | ?COMMON NAME | ?ec number | ?reconstruction category | ?reconstruction tool | ?reconstructio...\"" } ], "ns": 0, "title": "Manual-biomass reaction" }, { "pageid": 21, "revisions": [ { "revid": 22, "parentid": 0, "user": "Bot 27", "timestamp": "2019-10-14T15:38:50Z", "comment": "Created page with \"[[Category:Metabolite]] == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Dihydrouridines tRNA-Dihydrouridines] == * common name: ** a 5,6-dihydrouridine in tRNA *...\"" } ], "ns": 0, "title": "TRNA-Dihydrouridines" }, { "pageid": 22, "revisions": [ { "revid": 23, "parentid": 0, "user": "Bot 18", "timestamp": "2019-10-14T15:38:50Z", "comment": "Created page with \"=Workflow command history= ==Command sequence== * '''Check input''': ''Check the validity, consistency and presence of input files'' * '''Annotation based reconstruction''':...\"" } ], "ns": 0, "title": "Workflow" }, { "pageid": 23, "revisions": [ { "revid": 24, "parentid": 0, "user": "Bot 21", "timestamp": "2019-10-14T15:38:50Z", "comment": "Created page with \"{{#ask: [[Category:Reaction]] [[reconstruction source::manual-reactions_to_add_2]] | ?COMMON NAME | ?ec number | ?reconstruction category | ?reconstruction tool | ?reconstruct...\"" } ], "ns": 0, "title": "Manual-reactions to add 2" }, { "pageid": 24, "revisions": [ { "revid": 25, "parentid": 0, "user": "Bot 3", "timestamp": "2019-10-14T15:38:50Z", "comment": "Created page with \"{{#ask: [[Category:Reaction]] [[reconstruction source::orthology-galdieria.sulphuraria]] | ?COMMON NAME | ?ec number | ?reconstruction category | ?reconstruction tool | ?recon...\"" } ], "ns": 0, "title": "Orthology-galdieria.sulphuraria" }, { "pageid": 25, "revisions": [ { "revid": 26, "parentid": 0, "user": "Bot 23", "timestamp": "2019-10-14T15:38:50Z", "comment": "Created page with \"{{#ask: [[Category:Reaction]] [[reconstruction source::manual-import_from_medium]] | ?COMMON NAME | ?ec number | ?reconstruction category | ?reconstruction tool | ?reconstruct...\"" } ], "ns": 0, "title": "Manual-import from medium" }, { "pageid": 26, "revisions": [ { "revid": 27, "parentid": 0, "user": "Bot 5", "timestamp": "2019-10-14T15:38:50Z", "comment": "Created page with \"{{#ask: [[Category:Pathway]] | ?common name | ?reaction found | ?total reaction | ?completion rate }}\"" } ], "ns": 14, "title": "Category:Pathway" }, { "pageid": 27, "revisions": [ { "revid": 28, "parentid": 0, "user": "Bot 12", "timestamp": "2019-10-14T15:38:50Z", "comment": "Created page with \"{{#ask: [[Category:Reaction]] | ?common name | ?ec number | ?reconstruction category | ?reconstruction tool | ?reconstruction source | ?gene associated | ?in pathway }}\"" } ], "ns": 14, "title": "Category:Reaction" }, { "pageid": 30, "revisions": [ { "revid": 29, "parentid": 0, "user": "Bot 11", "timestamp": "2019-10-14T15:38:50Z", "comment": "Created page with \"{{#ask: [[Category:Reaction]] [[reconstruction source::manual-ala_dehy]] | ?COMMON NAME | ?ec number | ?reconstruction category | ?reconstruction tool | ?reconstruction source...\"" } ], "ns": 0, "title": "Manual-ala dehy" }, { "pageid": 29, "revisions": [ { "revid": 30, "parentid": 0, "user": "Bot 25", "timestamp": "2019-10-14T15:38:50Z", "comment": "Created page with \"{{#ask: [[Category:Reaction]] [[reconstruction source::manual-new_reactions_curation]] | ?COMMON NAME | ?ec number | ?reconstruction category | ?reconstruction tool | ?reconst...\"" } ], "ns": 0, "title": "Manual-new reactions curation" }, { "pageid": 28, "revisions": [ { "revid": 31, "parentid": 0, "user": "Bot 22", "timestamp": "2019-10-14T15:38:50Z", "comment": "Created page with \"{{#ask: [[Category:Reaction]] [[reconstruction source::manual-pathmodel_inference]] | ?COMMON NAME | ?ec number | ?reconstruction category | ?reconstruction tool | ?reconstruc...\"" } ], "ns": 0, "title": "Manual-pathmodel inference" }, { "pageid": 31, "revisions": [ { "revid": 32, "parentid": 0, "user": "Bot 0", "timestamp": "2019-10-14T15:38:50Z", "comment": "Created page with \"{{#ask: [[Category:Reaction]] [[reconstruction source::orthology-arabidopsis_thaliana]] | ?COMMON NAME | ?ec number | ?reconstruction category | ?reconstruction tool | ?recons...\"" } ], "ns": 0, "title": "Orthology-arabidopsis thaliana" }, { "pageid": 32, "revisions": [ { "revid": 33, "parentid": 0, "user": "Bot 2", "timestamp": "2019-10-14T15:38:50Z", "comment": "Created page with \"{{#ask: [[Category:Reaction]] [[reconstruction source::manual-pathmodel_inference_new_rxn_2]] | ?COMMON NAME | ?ec number | ?reconstruction category | ?reconstruction tool | ?...\"" } ], "ns": 0, "title": "Manual-pathmodel inference new rxn 2" }, { "pageid": 33, "revisions": [ { "revid": 34, "parentid": 0, "user": "Bot 13", "timestamp": "2019-10-14T15:38:50Z", "comment": "Created page with \"{{#ask: [[Category:Reaction]] [[reconstruction source::manual-pathmodel_inference_new_rxn]] | ?COMMON NAME | ?ec number | ?reconstruction category | ?reconstruction tool | ?re...\"" } ], "ns": 0, "title": "Manual-pathmodel inference new rxn" }, { "pageid": 34, "revisions": [ { "revid": 35, "parentid": 0, "user": "Bot 28", "timestamp": "2019-10-14T15:38:50Z", "comment": "Created page with \"[[Category:Metabolite]] == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-HYDROXY-3-KETO-5-METHYLTHIO-1-PHOSPHOP 2-HYDROXY-3-KETO-5-METHYLTHIO-1-PHOSPHOP] == * smiles:...\"" } ], "ns": 0, "title": "2-HYDROXY-3-KETO-5-METHYLTHIO-1-PHOSPHOP" }, { "pageid": 35, "revisions": [ { "revid": 36, "parentid": 0, "user": "Bot 29", "timestamp": "2019-10-14T15:38:50Z", "comment": "Created page with \"[[Category:Metabolite]] == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FARNESYL-PP FARNESYL-PP] == * smiles: ** CC(=CCCC(=CCCC(=CCOP(OP([O-])(=O)[O-])(=O)[O-])C)C)C *...\"" } ], "ns": 0, "title": "FARNESYL-PP" }, { "pageid": 36, "revisions": [ { "revid": 37, "parentid": 0, "user": "Bot 6", "timestamp": "2019-10-14T15:38:51Z", "comment": "Created page with \"{{#ask: [[Category:Reaction]] [[reconstruction source::orthology-ectocarpus_siliculosus]] | ?COMMON NAME | ?ec number | ?reconstruction category | ?reconstruction tool | ?reco...\"" } ], "ns": 0, "title": "Orthology-ectocarpus siliculosus" }, { "pageid": 37, "revisions": [ { "revid": 38, "parentid": 0, "user": "Bot 19", "timestamp": "2019-10-14T15:38:51Z", "comment": "Created page with \"[[Category:Metabolite]] == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19157 CPD-19157] == * smiles: ** CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)...\"" } ], "ns": 0, "title": "CPD-19157" }, { "pageid": 38, "revisions": [ { "revid": 39, "parentid": 0, "user": "Bot 27", "timestamp": "2019-10-14T15:38:51Z", "comment": "Created page with \"[[Category:Metabolite]] == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Oxo-glutarate-dehydro-suc-DH-lipoyl Oxo-glutarate-dehydro-suc-DH-lipoyl] == * common name: ** a...\"" } ], "ns": 0, "title": "Oxo-glutarate-dehydro-suc-DH-lipoyl" }, { "pageid": 39, "revisions": [ { "revid": 40, "parentid": 0, "user": "Bot 26", "timestamp": "2019-10-14T15:38:51Z", "comment": "Created page with \"[[Category:Metabolite]] == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-85 CPD-85] == * smiles: ** CSCCC(C([O-])=CO)=O * molecular weight: ** 161.195 * inchi k...\"" } ], "ns": 0, "title": "CPD-85" }, { "pageid": 40, "revisions": [ { "revid": 41, "parentid": 0, "user": "Bot 20", "timestamp": "2019-10-14T15:38:51Z", "comment": "Created page with \"[[Category:Metabolite]] == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-oxo-D5-steroids 3-oxo-D5-steroids] == * common name: ** a 3-oxo-δ5-steroid * Synonym(s)...\"" } ], "ns": 0, "title": "3-oxo-D5-steroids" }, { "pageid": 41, "revisions": [ { "revid": 42, "parentid": 0, "user": "Bot 24", "timestamp": "2019-10-14T15:38:51Z", "comment": "Created page with \"[[Category:Metabolite]] == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-oxo-stearoyl-ACPs 3-oxo-stearoyl-ACPs] == * common name: ** a 3-oxo-stearoyl-[acp] * Synonym(...\"" } ], "ns": 0, "title": "3-oxo-stearoyl-ACPs" }, { "pageid": 42, "revisions": [ { "revid": 43, "parentid": 0, "user": "Bot 4", "timestamp": "2019-10-14T15:38:51Z", "comment": "Created page with \"[[Category:Metabolite]] == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BCAA-dehydrogenase-3MB-DH-lipoyl BCAA-dehydrogenase-3MB-DH-lipoyl] == * common name: ** a [apo...\"" } ], "ns": 0, "title": "BCAA-dehydrogenase-3MB-DH-lipoyl" }, { "pageid": 43, "revisions": [ { "revid": 44, "parentid": 0, "user": "Bot 18", "timestamp": "2019-10-14T15:38:51Z", "comment": "Created page with \"[[Category:Metabolite]] == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NICOTINATE_NUCLEOTIDE NICOTINATE_NUCLEOTIDE] == * smiles: ** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O1...\"" } ], "ns": 0, "title": "NICOTINATE NUCLEOTIDE" }, { "pageid": 44, "revisions": [ { "revid": 45, "parentid": 0, "user": "Bot 15", "timestamp": "2019-10-14T15:38:51Z", "comment": "Created page with \"[[Category:Metabolite]] == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-MERCAPTO-PYRUVATE 3-MERCAPTO-PYRUVATE] == * smiles: ** C(C(C(=O)[O-])=O)S * molecular weight:...\"" } ], "ns": 0, "title": "3-MERCAPTO-PYRUVATE" }, { "pageid": 45, "revisions": [ { "revid": 46, "parentid": 0, "user": "Bot 23", "timestamp": "2019-10-14T15:38:51Z", "comment": "Created page with \"[[Category:Metabolite]] == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17319 CPD-17319] == * smiles: ** CCCCCCCCCCCCCCCCCC(=O)OCC(COP(=O)([O-])[O-])OC(CCCCCCCC=CC...\"" } ], "ns": 0, "title": "CPD-17319" }, { "pageid": 46, "revisions": [ { "revid": 47, "parentid": 0, "user": "Bot 14", "timestamp": "2019-10-14T15:38:51Z", "comment": "Created page with \"[[Category:Metabolite]] == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ETHANOL-AMINE ETHANOL-AMINE] == * smiles: ** C(CO)[N+] * molecular weight: ** 62.091 * inch...\"" } ], "ns": 0, "title": "ETHANOL-AMINE" }, { "pageid": 47, "revisions": [ { "revid": 48, "parentid": 0, "user": "Bot 3", "timestamp": "2019-10-14T15:38:51Z", "comment": "Created page with \"[[Category:Metabolite]] == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TETRACOSANOATE TETRACOSANOATE] == * smiles: ** CCCCCCCCCCCCCCCCCCCCCCCC([O-])=O * molecular wei...\"" } ], "ns": 0, "title": "TETRACOSANOATE" }, { "pageid": 48, "revisions": [ { "revid": 49, "parentid": 0, "user": "Bot 1", "timestamp": "2019-10-14T15:38:51Z", "comment": "Created page with \"[[Category:Metabolite]] == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-6-alpha-D-glucan 1-6-alpha-D-glucan] == * common name: ** a 1-6-α-D-glucan * Synonym(s)...\"" } ], "ns": 0, "title": "1-6-alpha-D-glucan" }, { "pageid": 49, "revisions": [ { "revid": 50, "parentid": 0, "user": "Bot 28", "timestamp": "2019-10-14T15:38:51Z", "comment": "Created page with \"[[Category:Metabolite]] == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10330 CPD-10330] == * smiles: ** C(C1(C(C(C(O1)O)O)O))O * molecular weight: ** 150.131...\"" } ], "ns": 0, "title": "CPD-10330" }, { "pageid": 50, "revisions": [ { "revid": 51, "parentid": 0, "user": "Bot 25", "timestamp": "2019-10-14T15:38:51Z", "comment": "Created page with \"[[Category:Metabolite]] == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2244 CPD0-2244] == * smiles: ** CCCCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC...\"" } ], "ns": 0, "title": "CPD0-2244" } ] } }