User contributions
Jump to navigation
Jump to search
(newest | oldest) View (newer 50 | older 50) (20 | 50 | 100 | 250 | 500)
- 10:28, 15 June 2021 (diff | hist) (+406) N Plastoquinols (Created page with "Category:metabolite == Metabolite Plastoquinols == * common-name: ** a plastoquinol == Reaction(s) known to consume the compound == * PLASTOQUINOL--PLASTOCYANIN-REDUCTAS...") (current)
- 10:28, 15 June 2021 (diff | hist) (+618) N CPD-15655 (Created page with "Category:metabolite == Metabolite CPD-15655 == * common-name: ** (3e)-undec-3-enoyl-coa * molecular-weight: ** 929.765 * smiles: ** cccccccc=ccc(=o)sccnc(=o)ccnc(=o)c(o)c(...") (current)
- 10:28, 15 June 2021 (diff | hist) (+574) N CPD-293 (Created page with "Category:metabolite == Metabolite CPD-293 == * common-name: ** 5-α-pregnane-3,20-dione * molecular-weight: ** 316.483 * smiles: ** cc(=o)[ch]3(cc[ch]4([ch]2(cc[ch]1(...") (current)
- 10:28, 15 June 2021 (diff | hist) (+364) N D-GLUCOSAMINE-6-P (Created page with "Category:metabolite == Metabolite D-GLUCOSAMINE-6-P == * common-name: ** d-glucosamine 6-phosphate == Reaction(s) known to consume the compound == * L-GLN-FRUCT-6-P-AMIN...") (current)
- 10:28, 15 June 2021 (diff | hist) (+607) N CPD-330 (Created page with "Category:metabolite == Metabolite CPD-330 == * common-name: ** l-galactono-1,4-lactone * molecular-weight: ** 178.141 * smiles: ** c(o)c(o)[ch]1(c(o)c(o)c(=o)o1) * inchi-k...") (current)
- 10:28, 15 June 2021 (diff | hist) (+493) N HSCN (Created page with "Category:metabolite == Metabolite HSCN == * common-name: ** thiocyanate * molecular-weight: ** 58.078 * smiles: ** c(#n)[s-] * inchi-key: ** zmzdmbwjuhkjps-uhfffaoysa-m ==...") (current)
- 10:28, 15 June 2021 (diff | hist) (+605) N CPD-4203 (Created page with "Category:metabolite == Metabolite CPD-4203 == * common-name: ** n6-(δ2-isopentenyl)-adenosine 5'-diphosphate * molecular-weight: ** 492.298 * smiles: ** cc(=ccnc3(=n...") (current)
- 10:28, 15 June 2021 (diff | hist) (+603) N CPD-1086 (Created page with "Category:metabolite == Metabolite CPD-1086 == * common-name: ** 5-amino-6-(5-phospho-d-ribitylamino)uracil * molecular-weight: ** 354.213 * smiles: ** c(nc1(nc(nc(=o)c(n)=...") (current)
- 10:28, 15 June 2021 (diff | hist) (+527) N CPD-4161 (Created page with "Category:metabolite == Metabolite CPD-4161 == * common-name: ** brassicasterol * molecular-weight: ** 398.671 * smiles: ** cc(c)c(c)c=cc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)c...") (current)
- 10:28, 15 June 2021 (diff | hist) (+537) N CPD-2747 (Created page with "Category:metabolite == Metabolite CPD-2747 == * common-name: ** cotinine-glucuronide * molecular-weight: ** 352.343 * smiles: ** c1(=o)(cc[ch](n(c)1)c3(c=[n+](c2(c(c(c(c(o...") (current)
- 10:28, 15 June 2021 (diff | hist) (+479) N 3-carboxy-3-dimethylammonio-propyl-L-his (Created page with "Category:metabolite == Metabolite 3-carboxy-3-dimethylammonio-propyl-L-his == * common-name: ** a 2-[(3s)-3-carboxy-3-(dimethylammonio)propyl]-l-histidine-[translation elo...") (current)
- 10:28, 15 June 2021 (diff | hist) (+425) N CPD-452 (Created page with "Category:metabolite == Metabolite CPD-452 == * common-name: ** a 6-(n-acetyl-α-d-glucosaminyl)-1-phosphatidyl-1d-myo-inositol == Reaction(s) known to consume the com...") (current)
- 10:28, 15 June 2021 (diff | hist) (+524) N 2-HYDROXY-2-METHYLPROPANENITRILE (Created page with "Category:metabolite == Metabolite 2-HYDROXY-2-METHYLPROPANENITRILE == * common-name: ** 2-hydroxy-2-methylpropanenitrile * molecular-weight: ** 85.105 * smiles: ** cc(o)(c...") (current)
- 10:28, 15 June 2021 (diff | hist) (+360) N DNA-containing-a-Apyrimidinic-Sites (Created page with "Category:metabolite == Metabolite DNA-containing-a-Apyrimidinic-Sites == * common-name: ** an apyrimidinic site in dna == Reaction(s) known to consume the compound == == R...") (current)
- 10:28, 15 June 2021 (diff | hist) (+1,536) N CPD-12575 (Created page with "Category:metabolite == Metabolite CPD-12575 == * common-name: ** udp-α-d-glucose * molecular-weight: ** 564.289 * smiles: ** c(o)c1(c(o)c(o)c(o)c(o1)op(op(=o)([o-])o...") (current)
- 10:28, 15 June 2021 (diff | hist) (+521) N BETA-L-ARABINOSE (Created page with "Category:metabolite == Metabolite BETA-L-ARABINOSE == * common-name: ** β-l-arabinopyranose * molecular-weight: ** 150.131 * smiles: ** c1(c(c(c(c(o1)o)o)o)o) * inchi...") (current)
- 10:28, 15 June 2021 (diff | hist) (+363) N Trans-D2-cis-cis-D17-35-C54-3-ACPs (Created page with "Category:metabolite == Metabolite trans-D2-cis-cis-D17-35-C54-3-ACPs == * common-name: ** a trans-delta2-cis,cis-delta17,35-c54:3-[acp] == Reaction(s) known to consume the...") (current)
- 10:28, 15 June 2021 (diff | hist) (+346) N Long-Chain-Acyl-ACPs (Created page with "Category:metabolite == Metabolite Long-Chain-Acyl-ACPs == * common-name: ** a long-chain acyl-[acyl-carrier protein] == Reaction(s) known to consume the compound == == Rea...") (current)
- 10:28, 15 June 2021 (diff | hist) (+499) N CPD-7836 (Created page with "Category:metabolite == Metabolite CPD-7836 == * common-name: ** myristate * molecular-weight: ** 227.366 * smiles: ** cccccccccccccc([o-])=o * inchi-key: ** tunfsrhwotwdnc...") (current)
- 10:28, 15 June 2021 (diff | hist) (+655) N CPD-17365 (Created page with "Category:metabolite == Metabolite CPD-17365 == * common-name: ** (4z,7z,10z,13z,16z)-docosapentaenoyl-coa * molecular-weight: ** 1075.997 * smiles: ** cccccc=ccc=ccc=ccc=c...") (current)
- 10:28, 15 June 2021 (diff | hist) (+521) N CPD-17543 (Created page with "Category:metabolite == Metabolite CPD-17543 == * common-name: ** dapdiamide e * molecular-weight: ** 316.313 * smiles: ** cc(c)c(c(=o)[o-])nc(=o)c(c[n+])nc(=o)c1(oc(c(=o)n...") (current)
- 10:28, 15 June 2021 (diff | hist) (+598) N CPD-17375 (Created page with "Category:metabolite == Metabolite CPD-17375 == * common-name: ** 1-[18-hydroxyoeoyl]-2-[18-hydroxy-lioleoyl]-sn-glycerol * molecular-weight: ** 650.978 * smiles: ** c(o)cc...") (current)
- 10:28, 15 June 2021 (diff | hist) (+347) N RNASE-III-MRNA-PROCESSING-SUBSTRATE (Created page with "Category:metabolite == Metabolite RNASE-III-MRNA-PROCESSING-SUBSTRATE == * common-name: ** rnase iii mrna processing substrate == Reaction(s) known to consume the compound...") (current)
- 10:28, 15 June 2021 (diff | hist) (+679) N CPD-17264 (Created page with "Category:metabolite == Metabolite CPD-17264 == * common-name: ** (2e,8z,11z,14z,17z)-icosa-2,8,11,14,17-pentaenoyl-coa * molecular-weight: ** 1047.943 * smiles: ** ccc=ccc...") (current)
- 10:28, 15 June 2021 (diff | hist) (+410) N Carboxyadenylated-MPT-synthases (Created page with "Category:metabolite == Metabolite Carboxyadenylated-MPT-synthases == * common-name: ** a carboxy-adenylated [small subunit of molybdopterin synthase] == Reaction(s) known...") (current)
- 10:28, 15 June 2021 (diff | hist) (+514) N HOMO-CIT (Created page with "Category:metabolite == Metabolite HOMO-CIT == * common-name: ** (2r)-homocitrate * molecular-weight: ** 203.128 * smiles: ** c(c([o-])=o)cc(o)(c([o-])=o)cc([o-])=o * inchi...") (current)
- 10:28, 15 June 2021 (diff | hist) (+618) N CPD-14392 (Created page with "Category:metabolite == Metabolite CPD-14392 == * common-name: ** stearidonoyl-coa * molecular-weight: ** 1021.905 * smiles: ** ccc=ccc=ccc=ccc=cccccc(=o)sccnc(=o)ccnc(=o)c...") (current)
- 10:28, 15 June 2021 (diff | hist) (+497) N MENADIOL (Created page with "Category:metabolite == Metabolite MENADIOL == * common-name: ** menadiol * molecular-weight: ** 174.199 * smiles: ** cc1(=cc(o)=c2(c=cc=cc(=c(o)1)2)) * inchi-key: ** zjtlz...") (current)
- 10:28, 15 June 2021 (diff | hist) (+678) N 4-DEOXY-BETA-D-GLUC-4-ENURONOSYL-6S (Created page with "Category:metabolite == Metabolite 4-DEOXY-BETA-D-GLUC-4-ENURONOSYL-6S == * common-name: ** 4-deoxy-β-d-gluc-4-enuronosyl-(1,3)-n-acetyl--d-galactosamine 6-sulfate * m...") (current)
- 10:28, 15 June 2021 (diff | hist) (+456) N ACRYLAMIDE (Created page with "Category:metabolite == Metabolite ACRYLAMIDE == * common-name: ** acrylamide * molecular-weight: ** 71.079 * smiles: ** c=cc(=o)n * inchi-key: ** hrpvxlwxlxdghg-uhfffaoysa...") (current)
- 10:28, 15 June 2021 (diff | hist) (+305) N 23S-rRNA-uridine2605 (Created page with "Category:metabolite == Metabolite 23S-rRNA-uridine2605 == * common-name: ** uridine2605 in 23s rrna == Reaction(s) known to consume the compound == * RXN-11836 == Reac...") (current)
- 10:28, 15 June 2021 (diff | hist) (+790) N 2-METHYL-3-HYDROXY-BUTYRYL-COA (Created page with "Category:metabolite == Metabolite 2-METHYL-3-HYDROXY-BUTYRYL-COA == * common-name: ** (2s,3s)-3-hydroxy-2-methylbutanoyl-coa * molecular-weight: ** 863.619 * smiles: ** cc...") (current)
- 10:28, 15 June 2021 (diff | hist) (+370) N 3R-11Z-3-hydroxy-icos-11-enoyl-ACPs (Created page with "Category:metabolite == Metabolite 3R-11Z-3-hydroxy-icos-11-enoyl-ACPs == * common-name: ** a (3r,11z)-3-hydroxy-icos-11-enoyl-[acp] == Reaction(s) known to consume the com...") (current)
- 10:28, 15 June 2021 (diff | hist) (+620) N 2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE (Created page with "Category:metabolite == Metabolite 2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE == * common-name: ** 2-c-methyl-d-erythritol-2,4-cyclodiphosphate * molecular-weight: ** 276.076 *...") (current)
- 10:28, 15 June 2021 (diff | hist) (+472) N METHYLBUT-CPD (Created page with "Category:metabolite == Metabolite METHYLBUT-CPD == * common-name: ** 2-methylbutanal * molecular-weight: ** 86.133 * smiles: ** ccc(c)[ch]=o * inchi-key: ** bygqbdhughbgmd...") (current)
- 10:28, 15 June 2021 (diff | hist) (+381) N Protein-L-Asparagine (Created page with "Category:metabolite == Metabolite Protein-L-Asparagine == * common-name: ** a [protein]-l-asparagine == Reaction(s) known to consume the compound == * 2.4.1.119-RXN *...") (current)
- 10:28, 15 June 2021 (diff | hist) (+532) N CPD-707 (Created page with "Category:metabolite == Metabolite CPD-707 == * common-name: ** campesterol * molecular-weight: ** 400.687 * smiles: ** cc(c)c(c)ccc(c)[ch]3(cc[ch]4([ch]2(cc=c1(cc(o)ccc(c)...") (current)
- 10:28, 15 June 2021 (diff | hist) (+293) N Seminolipids (Created page with "Category:metabolite == Metabolite Seminolipids == * common-name: ** a seminolipid == Reaction(s) known to consume the compound == * RXN-17203 == Reaction(s) known to p...") (current)
- 10:28, 15 June 2021 (diff | hist) (+337) N R-3-hydroxystearoyl-ACPs (Created page with "Category:metabolite == Metabolite R-3-hydroxystearoyl-ACPs == * common-name: ** a (3r)-3-hydroxystearoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9634...") (current)
- 10:28, 15 June 2021 (diff | hist) (+339) N G-5-prime-PP-5-prime-DNA (Created page with "Category:metabolite == Metabolite G-5-prime-PP-5-prime-DNA == * common-name: ** guaosine-5'-diphospho-5'-[dna] == Reaction(s) known to consume the compound == * RXN-1792...") (current)
- 10:28, 15 June 2021 (diff | hist) (+602) N CPD-8078 (Created page with "Category:metabolite == Metabolite CPD-8078 == * common-name: ** 1-18:3-2-16:2-monogalactosyldiacylglycerol * molecular-weight: ** 749.036 * smiles: ** ccc=ccc=ccc=cccccccc...") (current)
- 10:28, 15 June 2021 (diff | hist) (+490) N SEPO3 (Created page with "Category:metabolite == Metabolite SEPO3 == * common-name: ** selenophosphate * molecular-weight: ** 158.94 * smiles: ** [o-]p([o-])(o)=[se] * inchi-key: ** jrphgdyskgjtkz-...") (current)
- 10:28, 15 June 2021 (diff | hist) (+484) N PARAOXON (Created page with "Category:metabolite == Metabolite PARAOXON == * common-name: ** paraoxon * molecular-weight: ** 275.197 * smiles: ** ccop(oc1(c=cc(=cc=1)[n+]([o-])=o))(occ)=o * inchi-key:...") (current)
- 10:28, 15 June 2021 (diff | hist) (+395) N CPD-17352 (Created page with "Category:metabolite == Metabolite CPD-17352 == * common-name: ** a [glycerolipid]-(11z,14z,17z)-icosatrienoate * smiles: ** ccc=ccc=ccc=ccccccccccc(=o)[a glycerolipid] ==...") (current)
- 10:27, 15 June 2021 (diff | hist) (+555) N CPD-9957 (Created page with "Category:metabolite == Metabolite CPD-9957 == * common-name: ** ubiquinol-9 * molecular-weight: ** 797.255 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(...") (current)
- 10:27, 15 June 2021 (diff | hist) (+341) N RNASE-III-PROCESSING-PRODUCT-MRNA (Created page with "Category:metabolite == Metabolite RNASE-III-PROCESSING-PRODUCT-MRNA == * common-name: ** rnase iii processing product mrna == Reaction(s) known to consume the compound ==...") (current)
- 10:27, 15 June 2021 (diff | hist) (+339) N Aryl-beta-D-Glucosides (Created page with "Category:metabolite == Metabolite Aryl-beta-D-Glucosides == * common-name: ** an aryl β-d-glucoside == Reaction(s) known to consume the compound == == Reaction(s) kno...") (current)
- 10:27, 15 June 2021 (diff | hist) (+618) N CPD-9406 (Created page with "Category:metabolite == Metabolite CPD-9406 == * common-name: ** (2s)-ethylmalonyl-coa * molecular-weight: ** 876.595 * smiles: ** ccc(c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)...") (current)
- 10:27, 15 June 2021 (diff | hist) (+598) N CDP-ETHANOLAMINE (Created page with "Category:metabolite == Metabolite CDP-ETHANOLAMINE == * common-name: ** cdp-ethanolamine * molecular-weight: ** 445.239 * smiles: ** c(cop(op(occ2(c(c(c(n1(c(n=c(c=c1)n)=o...") (current)
- 10:27, 15 June 2021 (diff | hist) (+260) N FRU (Created page with "Category:metabolite == Metabolite FRU == * common-name: ** d-fructose == Reaction(s) known to consume the compound == * SBTD_D2 == Reaction(s) known to produce the com...") (current)
(newest | oldest) View (newer 50 | older 50) (20 | 50 | 100 | 250 | 500)