Difference between revisions of "3-METHYLSULFINYLPROPYL-GLUCOSINOLATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite TYR == * common-name: ** l-tyrosine * molecular-weight: ** 181.191 * inchi-key: ** ouycccasqsfeme-qmmmgpobsa-n * smiles: ** c(c(cc1(c=cc(...") |
(Created page with "Category:metabolite == Metabolite CPD-13375 == * common-name: ** xxxg xyloglucan oligosaccharide * molecular-weight: ** 1062.931 * inchi-key: ** pzupagrihcrvkn-sphbqonksa-...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-13375 == |
* common-name: | * common-name: | ||
− | ** | + | ** xxxg xyloglucan oligosaccharide |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 1062.931 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** pzupagrihcrvkn-sphbqonksa-n |
* smiles: | * smiles: | ||
− | ** c(c( | + | ** c1(c(c(c(c(o1)occ2(oc(c(o)c(o)c(o)2)oc4(c(o)c(o)c(oc(coc3(c(c(c(co3)o)o)o))4)oc6(c(o)c(o)c(oc(coc5(c(c(c(co5)o)o)o))6)oc7(c(o)c(o)c(o)oc(co)7)))))o)o)o) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-12398]] |
− | * [[ | + | * [[RXN-12399]] |
+ | * [[RXN-12400]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=xxxg xyloglucan oligosaccharide}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=1062.931}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=pzupagrihcrvkn-sphbqonksa-n}} |
Revision as of 17:50, 13 January 2021
Contents
Metabolite CPD-13375
- common-name:
- xxxg xyloglucan oligosaccharide
- molecular-weight:
- 1062.931
- inchi-key:
- pzupagrihcrvkn-sphbqonksa-n
- smiles:
- c1(c(c(c(c(o1)occ2(oc(c(o)c(o)c(o)2)oc4(c(o)c(o)c(oc(coc3(c(c(c(co3)o)o)o))4)oc6(c(o)c(o)c(oc(coc5(c(c(c(co5)o)o)o))6)oc7(c(o)c(o)c(o)oc(co)7)))))o)o)o)