Difference between revisions of "3-Hydroxy-octanoyl-ACPs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15685 == * common-name: ** 2-trans, 5-cis, 7-trans-tetradecatrienoyl-coa * molecular-weight: ** 967.814 * inchi-key: ** xpvhxtguzgacr...")
 
(Created page with "Category:metabolite == Metabolite CPD1F-138 == * common-name: ** gibberellin a12-aldehyde * molecular-weight: ** 315.431 * inchi-key: ** zctunyrxjklwpy-llcokinksa-m * smil...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15685 ==
+
== Metabolite CPD1F-138 ==
 
* common-name:
 
* common-name:
** 2-trans, 5-cis, 7-trans-tetradecatrienoyl-coa
+
** gibberellin a12-aldehyde
 
* molecular-weight:
 
* molecular-weight:
** 967.814
+
** 315.431
 
* inchi-key:
 
* inchi-key:
** xpvhxtguzgacru-mcfmhthasa-j
+
** zctunyrxjklwpy-llcokinksa-m
 
* smiles:
 
* smiles:
** ccccccc=cc=ccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c=c1(c2(cc3(c1)(c([ch]4(c(c)(cccc(c)([ch](cc2)3)4)c([o-])=o))c=o)))
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN1F-161]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14796]]
+
* [[RXN1F-160]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-trans, 5-cis, 7-trans-tetradecatrienoyl-coa}}
+
{{#set: common-name=gibberellin a12-aldehyde}}
{{#set: molecular-weight=967.814}}
+
{{#set: molecular-weight=315.431}}
{{#set: inchi-key=inchikey=xpvhxtguzgacru-mcfmhthasa-j}}
+
{{#set: inchi-key=inchikey=zctunyrxjklwpy-llcokinksa-m}}

Revision as of 17:50, 13 January 2021

Metabolite CPD1F-138

  • common-name:
    • gibberellin a12-aldehyde
  • molecular-weight:
    • 315.431
  • inchi-key:
    • zctunyrxjklwpy-llcokinksa-m
  • smiles:
    • c=c1(c2(cc3(c1)(c([ch]4(c(c)(cccc(c)([ch](cc2)3)4)c([o-])=o))c=o)))

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality