Difference between revisions of "3-carboxy-3-dimethylammonio-propyl-L-his"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite TRIPEPTIDES == * common-name: ** a tripeptide == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compoun...") |
(Created page with "Category:metabolite == Metabolite CPD-17815 == * common-name: ** (11z)-3-oxo-hexadecenoyl-coa * molecular-weight: ** 1013.883 * inchi-key: ** lgtvdwicxibioi-ubpkjmqesa-j *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-17815 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (11z)-3-oxo-hexadecenoyl-coa |
| + | * molecular-weight: | ||
| + | ** 1013.883 | ||
| + | * inchi-key: | ||
| + | ** lgtvdwicxibioi-ubpkjmqesa-j | ||
| + | * smiles: | ||
| + | ** ccccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-16559]] | ||
| + | * [[RXN-16561]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-16559]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(11z)-3-oxo-hexadecenoyl-coa}} |
| + | {{#set: molecular-weight=1013.883}} | ||
| + | {{#set: inchi-key=inchikey=lgtvdwicxibioi-ubpkjmqesa-j}} | ||
Revision as of 17:51, 13 January 2021
Contents
Metabolite CPD-17815
- common-name:
- (11z)-3-oxo-hexadecenoyl-coa
- molecular-weight:
- 1013.883
- inchi-key:
- lgtvdwicxibioi-ubpkjmqesa-j
- smiles:
- ccccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
