Difference between revisions of "B-KETOACYL-ACP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-476 == * common-name: ** 4-(2-aminophenyl)-2,4-dioxobutanoate * molecular-weight: ** 206.177 * inchi-key: ** caovwyzqmpnafj-uhfffaoys...")
 
(Created page with "Category:metabolite == Metabolite CPD-19157 == * common-name: ** 3-oxo-(7z)-tetradecenoyl-coa * molecular-weight: ** 985.829 * inchi-key: ** bepllrgjvxaeji-twafkmgksa-j *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-476 ==
+
== Metabolite CPD-19157 ==
 
* common-name:
 
* common-name:
** 4-(2-aminophenyl)-2,4-dioxobutanoate
+
** 3-oxo-(7z)-tetradecenoyl-coa
 
* molecular-weight:
 
* molecular-weight:
** 206.177
+
** 985.829
 
* inchi-key:
 
* inchi-key:
** caovwyzqmpnafj-uhfffaoysa-m
+
** bepllrgjvxaeji-twafkmgksa-j
 
* smiles:
 
* smiles:
** c(c(cc(c1(c(=cc=cc=1)n))=o)=o)([o-])=o
+
** ccccccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.6.1.63-RXN]]
+
* [[RXN-17795]]
* [[2.6.1.7-RXN]]
 
* [[RXN-10720]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.6.1.63-RXN]]
+
* [[RXN-17794]]
* [[2.6.1.7-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-(2-aminophenyl)-2,4-dioxobutanoate}}
+
{{#set: common-name=3-oxo-(7z)-tetradecenoyl-coa}}
{{#set: molecular-weight=206.177}}
+
{{#set: molecular-weight=985.829}}
{{#set: inchi-key=inchikey=caovwyzqmpnafj-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=bepllrgjvxaeji-twafkmgksa-j}}

Revision as of 17:52, 13 January 2021

Metabolite CPD-19157

  • common-name:
    • 3-oxo-(7z)-tetradecenoyl-coa
  • molecular-weight:
    • 985.829
  • inchi-key:
    • bepllrgjvxaeji-twafkmgksa-j
  • smiles:
    • ccccccc=ccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality