Difference between revisions of "Nucleotides"

Revision as of 17:54, 13 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-14604 ==
+== Metabolite 18-HYDROXYOLEATE ==
 * common-name:
-** mycophenolic acid phenolic glucuronide
+** 18-hydroxyoleate
 * molecular-weight:
-** 494.451
+** 297.457
 * inchi-key:
-** byfgtsayqqiucn-hgihdbqlsa-l
+** lquhzvlttwmbto-uphrsurjsa-m
 * smiles:
-** cc(ccc([o-])=o)=ccc2(=c(c(c)=c3(coc(=o)c(=c(oc1(c(o)c(c(o)c(c([o-])=o)o1)o))2)3))oc)
+** c(o)cccccccc=ccccccccc(=o)[o-]
 == Reaction(s) known to consume the compound ==
+* [[RXN-16402]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-13608]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=mycophenolic acid phenolic glucuronide}}
+{{#set: common-name=18-hydroxyoleate}}
-{{#set: molecular-weight=494.451}}
+{{#set: molecular-weight=297.457}}
-{{#set: inchi-key=inchikey=byfgtsayqqiucn-hgihdbqlsa-l}}
+{{#set: inchi-key=inchikey=lquhzvlttwmbto-uphrsurjsa-m}}