Difference between revisions of "18-HYDROXYOLEATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite L-ALPHA-AMINO-EPSILON-KETO-PIMELATE == * common-name: ** l-α-amino-ε-keto-pimelate * molecular-weight: ** 188.16 * inchi-ke...")
 
(Created page with "Category:metabolite == Metabolite ACETALD == * common-name: ** acetaldehyde * molecular-weight: ** 44.053 * inchi-key: ** ikhguxgnuitlkf-uhfffaoysa-n * smiles: ** c[ch]=o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite L-ALPHA-AMINO-EPSILON-KETO-PIMELATE ==
+
== Metabolite ACETALD ==
 
* common-name:
 
* common-name:
** l-α-amino-ε-keto-pimelate
+
** acetaldehyde
 
* molecular-weight:
 
* molecular-weight:
** 188.16
+
** 44.053
 
* inchi-key:
 
* inchi-key:
** ukcsfklwnhubdy-bypyzucnsa-m
+
** ikhguxgnuitlkf-uhfffaoysa-n
 
* smiles:
 
* smiles:
** c([o-])(=o)c(cccc(c([o-])=o)=o)[n+]
+
** c[ch]=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-4821]]
+
* [[ALCOHOL-DEHYDROG-RXN]]
 +
* [[RXN-12484]]
 +
* [[RXN0-3962]]
 +
* [[RXN66-3]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-4821]]
+
* [[2-NITROPROPANE-DIOXYGENASE-RXN]]
 +
* [[ALCOHOL-DEHYDROG-RXN]]
 +
* [[LTAA-RXN]]
 +
* [[RXN66-1]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-α-amino-ε-keto-pimelate}}
+
{{#set: common-name=acetaldehyde}}
{{#set: molecular-weight=188.16}}
+
{{#set: molecular-weight=44.053}}
{{#set: inchi-key=inchikey=ukcsfklwnhubdy-bypyzucnsa-m}}
+
{{#set: inchi-key=inchikey=ikhguxgnuitlkf-uhfffaoysa-n}}

Revision as of 17:54, 13 January 2021

Metabolite ACETALD

  • common-name:
    • acetaldehyde
  • molecular-weight:
    • 44.053
  • inchi-key:
    • ikhguxgnuitlkf-uhfffaoysa-n
  • smiles:
    • c[ch]=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality