Difference between revisions of "4-Hydroxy-3-polyprenylbenzoates"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17281 == * common-name: ** a [glycerolipid]-(8z,11z,14z,17z)-icosatetraenoate == Reaction(s) known to consume the compound == == Reac...") |
(Created page with "Category:metabolite == Metabolite L-ALPHA-AMINO-EPSILON-KETO-PIMELATE == * common-name: ** l-α-amino-ε-keto-pimelate * molecular-weight: ** 188.16 * inchi-ke...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite L-ALPHA-AMINO-EPSILON-KETO-PIMELATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** l-α-amino-ε-keto-pimelate |
| + | * molecular-weight: | ||
| + | ** 188.16 | ||
| + | * inchi-key: | ||
| + | ** ukcsfklwnhubdy-bypyzucnsa-m | ||
| + | * smiles: | ||
| + | ** c([o-])(=o)c(cccc(c([o-])=o)=o)[n+] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-4821]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-4821]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=l-α-amino-ε-keto-pimelate}} |
| + | {{#set: molecular-weight=188.16}} | ||
| + | {{#set: inchi-key=inchikey=ukcsfklwnhubdy-bypyzucnsa-m}} | ||
Revision as of 17:54, 13 January 2021
Contents
Metabolite L-ALPHA-AMINO-EPSILON-KETO-PIMELATE
- common-name:
- l-α-amino-ε-keto-pimelate
- molecular-weight:
- 188.16
- inchi-key:
- ukcsfklwnhubdy-bypyzucnsa-m
- smiles:
- c([o-])(=o)c(cccc(c([o-])=o)=o)[n+]
