Difference between revisions of "PRO-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ADENINE == * common-name: ** adenine * molecular-weight: ** 135.128 * inchi-key: ** gffgjbxgbjisgv-uhfffaoysa-n * smiles: ** c1(n)(n=cn=c...") |
(Created page with "Category:metabolite == Metabolite CPD-730 == * common-name: ** 8-[(1r,2r)-3-oxo-2-{(z)-pent-2-enyl}cyclopentyl]octanoate * molecular-weight: ** 293.425 * inchi-key: ** bzx...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-730 == |
* common-name: | * common-name: | ||
− | ** | + | ** 8-[(1r,2r)-3-oxo-2-{(z)-pent-2-enyl}cyclopentyl]octanoate |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 293.425 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** bzxzfdkirzbjep-jmtmcxqrsa-m |
* smiles: | * smiles: | ||
− | ** | + | ** ccc=ccc1(c(ccc(=o)1)cccccccc([o-])=o) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[12-OXOPHYTODIENOATE-REDUCTASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=8-[(1r,2r)-3-oxo-2-{(z)-pent-2-enyl}cyclopentyl]octanoate}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=293.425}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=bzxzfdkirzbjep-jmtmcxqrsa-m}} |
Revision as of 17:57, 13 January 2021
Contents
Metabolite CPD-730
- common-name:
- 8-[(1r,2r)-3-oxo-2-{(z)-pent-2-enyl}cyclopentyl]octanoate
- molecular-weight:
- 293.425
- inchi-key:
- bzxzfdkirzbjep-jmtmcxqrsa-m
- smiles:
- ccc=ccc1(c(ccc(=o)1)cccccccc([o-])=o)
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
{{#set: common-name=8-[(1r,2r)-3-oxo-2-{(z)-pent-2-enyl}cyclopentyl]octanoate}}