Difference between revisions of "PRO-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ADENINE == * common-name: ** adenine * molecular-weight: ** 135.128 * inchi-key: ** gffgjbxgbjisgv-uhfffaoysa-n * smiles: ** c1(n)(n=cn=c...")
 
(Created page with "Category:metabolite == Metabolite CPD-730 == * common-name: ** 8-[(1r,2r)-3-oxo-2-{(z)-pent-2-enyl}cyclopentyl]octanoate * molecular-weight: ** 293.425 * inchi-key: ** bzx...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ADENINE ==
+
== Metabolite CPD-730 ==
 
* common-name:
 
* common-name:
** adenine
+
** 8-[(1r,2r)-3-oxo-2-{(z)-pent-2-enyl}cyclopentyl]octanoate
 
* molecular-weight:
 
* molecular-weight:
** 135.128
+
** 293.425
 
* inchi-key:
 
* inchi-key:
** gffgjbxgbjisgv-uhfffaoysa-n
+
** bzxzfdkirzbjep-jmtmcxqrsa-m
 
* smiles:
 
* smiles:
** c1(n)(n=cn=c2(nc=nc=12))
+
** ccc=ccc1(c(ccc(=o)1)cccccccc([o-])=o)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ADENPRIBOSYLTRAN-RXN]]
 
* [[RXN-15139]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[METHYLTHIOADENOSINE-NUCLEOSIDASE-RXN]]
+
* [[12-OXOPHYTODIENOATE-REDUCTASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=adenine}}
+
{{#set: common-name=8-[(1r,2r)-3-oxo-2-{(z)-pent-2-enyl}cyclopentyl]octanoate}}
{{#set: molecular-weight=135.128}}
+
{{#set: molecular-weight=293.425}}
{{#set: inchi-key=inchikey=gffgjbxgbjisgv-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=bzxzfdkirzbjep-jmtmcxqrsa-m}}

Revision as of 17:57, 13 January 2021

Metabolite CPD-730

  • common-name:
    • 8-[(1r,2r)-3-oxo-2-{(z)-pent-2-enyl}cyclopentyl]octanoate
  • molecular-weight:
    • 293.425
  • inchi-key:
    • bzxzfdkirzbjep-jmtmcxqrsa-m
  • smiles:
    • ccc=ccc1(c(ccc(=o)1)cccccccc([o-])=o)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

{{#set: common-name=8-[(1r,2r)-3-oxo-2-{(z)-pent-2-enyl}cyclopentyl]octanoate}}