Difference between revisions of "COUMARATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5Z8Z11Z14Z17Z-EICOSAPENTAENOATE == * common-name: ** (5z,8z,11z,14z,17z)-icosapentaenoate * molecular-weight: ** 301.448 * inchi-key: **...")
(Created page with "Category:metabolite == Metabolite Apocytochromes-c == * common-name: ** an apo-[c-type cytochrome] == Reaction(s) known to consume the compound == * HOLOCYTOCHROME-C-SYN...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 5Z8Z11Z14Z17Z-EICOSAPENTAENOATE ==
+
== Metabolite Apocytochromes-c ==
 
* common-name:
 
* common-name:
** (5z,8z,11z,14z,17z)-icosapentaenoate
+
** an apo-[c-type cytochrome]
* molecular-weight:
 
** 301.448
 
* inchi-key:
 
** jazbehyotptenj-jlnkqsitsa-m
 
* smiles:
 
** ccc=ccc=ccc=ccc=ccc=ccccc(=o)[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-12978]]
+
* [[HOLOCYTOCHROME-C-SYNTHASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13431]]
+
* [[HOLOCYTOCHROME-C-SYNTHASE-RXN]]
* [[RXN-16139]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(5z,8z,11z,14z,17z)-icosapentaenoate}}
+
{{#set: common-name=an apo-[c-type cytochrome]}}
{{#set: molecular-weight=301.448}}
 
{{#set: inchi-key=inchikey=jazbehyotptenj-jlnkqsitsa-m}}
 

Revision as of 15:05, 15 March 2021

Metabolite Apocytochromes-c

  • common-name:
    • an apo-[c-type cytochrome]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an apo-[c-type cytochrome" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.