Difference between revisions of "CPD-7670"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Secondary-Alcohols == * common-name: ** a secondary alcohol == Reaction(s) known to consume the compound == * CARBONYL-REDUCTASE-NADPH-...") |
(Created page with "Category:metabolite == Metabolite CPD-17866 == * common-name: ** s-sulfinatoglutathione * molecular-weight: ** 369.364 * inchi-key: ** qubutnszzfichl-wdskdsinsa-l * smiles...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-17866 == |
* common-name: | * common-name: | ||
| − | ** | + | ** s-sulfinatoglutathione |
| + | * molecular-weight: | ||
| + | ** 369.364 | ||
| + | * inchi-key: | ||
| + | ** qubutnszzfichl-wdskdsinsa-l | ||
| + | * smiles: | ||
| + | ** c(ss([o-])=o)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-16574]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[FESGSHTHIO-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=s-sulfinatoglutathione}} |
| + | {{#set: molecular-weight=369.364}} | ||
| + | {{#set: inchi-key=inchikey=qubutnszzfichl-wdskdsinsa-l}} | ||
Revision as of 15:05, 15 March 2021
Contents
Metabolite CPD-17866
- common-name:
- s-sulfinatoglutathione
- molecular-weight:
- 369.364
- inchi-key:
- qubutnszzfichl-wdskdsinsa-l
- smiles:
- c(ss([o-])=o)c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
