Difference between revisions of "3-carboxy-3-dimethylammonio-propyl-L-his"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17815 == * common-name: ** (11z)-3-oxo-hexadecenoyl-coa * molecular-weight: ** 1013.883 * inchi-key: ** lgtvdwicxibioi-ubpkjmqesa-j *...")
(Created page with "Category:metabolite == Metabolite L-Fucopyranoses == * common-name: ** l-fucopyranose == Reaction(s) known to consume the compound == * FUCOKINASE-RXN * RXN-14813...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17815 ==
+
== Metabolite L-Fucopyranoses ==
 
* common-name:
 
* common-name:
** (11z)-3-oxo-hexadecenoyl-coa
+
** l-fucopyranose
* molecular-weight:
 
** 1013.883
 
* inchi-key:
 
** lgtvdwicxibioi-ubpkjmqesa-j
 
* smiles:
 
** ccccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16559]]
+
* [[FUCOKINASE-RXN]]
* [[RXN-16561]]
+
* [[RXN-14813]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16559]]
+
* [[12-ALPHA-L-FUCOSIDASE-RXN]]
 +
* [[ALPHA-L-FUCOSIDASE-RXN]]
 +
* [[RXN-14813]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(11z)-3-oxo-hexadecenoyl-coa}}
+
{{#set: common-name=l-fucopyranose}}
{{#set: molecular-weight=1013.883}}
 
{{#set: inchi-key=inchikey=lgtvdwicxibioi-ubpkjmqesa-j}}
 

Revision as of 15:06, 15 March 2021

Metabolite L-Fucopyranoses

  • common-name:
    • l-fucopyranose

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality