Difference between revisions of "CPD-504"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-HYDROXY-PROPIONYL-COA == * common-name: ** 3-hydroxypropanoyl-coa * molecular-weight: ** 835.566 * inchi-key: ** berbfzcusmqabm-iexphml...") |
(Created page with "Category:metabolite == Metabolite OCTAPRENYL-DIPHOSPHATE == * common-name: ** all-trans-octaprenyl diphosphate * molecular-weight: ** 719.897 * inchi-key: ** ikkldissulffq...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite OCTAPRENYL-DIPHOSPHATE == |
* common-name: | * common-name: | ||
− | ** | + | ** all-trans-octaprenyl diphosphate |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 719.897 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ikkldissulffqo-djmiluhssa-k |
* smiles: | * smiles: | ||
− | ** cc(c)(c( | + | ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-] |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[4OHBENZOATE-OCTAPRENYLTRANSFER-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=all-trans-octaprenyl diphosphate}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=719.897}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ikkldissulffqo-djmiluhssa-k}} |
Revision as of 15:06, 15 March 2021
Contents
Metabolite OCTAPRENYL-DIPHOSPHATE
- common-name:
- all-trans-octaprenyl diphosphate
- molecular-weight:
- 719.897
- inchi-key:
- ikkldissulffqo-djmiluhssa-k
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]