Difference between revisions of "CPD-504"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-HYDROXY-PROPIONYL-COA == * common-name: ** 3-hydroxypropanoyl-coa * molecular-weight: ** 835.566 * inchi-key: ** berbfzcusmqabm-iexphml...")
(Created page with "Category:metabolite == Metabolite OCTAPRENYL-DIPHOSPHATE == * common-name: ** all-trans-octaprenyl diphosphate * molecular-weight: ** 719.897 * inchi-key: ** ikkldissulffq...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-HYDROXY-PROPIONYL-COA ==
+
== Metabolite OCTAPRENYL-DIPHOSPHATE ==
 
* common-name:
 
* common-name:
** 3-hydroxypropanoyl-coa
+
** all-trans-octaprenyl diphosphate
 
* molecular-weight:
 
* molecular-weight:
** 835.566
+
** 719.897
 
* inchi-key:
 
* inchi-key:
** berbfzcusmqabm-iexphmlfsa-j
+
** ikkldissulffqo-djmiluhssa-k
 
* smiles:
 
* smiles:
** cc(c)(c(o)c(=o)nccc(=o)nccsc(cco)=o)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-6383]]
+
* [[4OHBENZOATE-OCTAPRENYLTRANSFER-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-6383]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-hydroxypropanoyl-coa}}
+
{{#set: common-name=all-trans-octaprenyl diphosphate}}
{{#set: molecular-weight=835.566}}
+
{{#set: molecular-weight=719.897}}
{{#set: inchi-key=inchikey=berbfzcusmqabm-iexphmlfsa-j}}
+
{{#set: inchi-key=inchikey=ikkldissulffqo-djmiluhssa-k}}

Revision as of 15:06, 15 March 2021

Metabolite OCTAPRENYL-DIPHOSPHATE

  • common-name:
    • all-trans-octaprenyl diphosphate
  • molecular-weight:
    • 719.897
  • inchi-key:
    • ikkldissulffqo-djmiluhssa-k
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop(=o)([o-])op(=o)([o-])[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality