Difference between revisions of "4-hydroxybenzoate"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7418 == * common-name: ** coumarinate * molecular-weight: ** 163.152 * inchi-key: ** pmowtihvnwzyfi-waywqwqtsa-m * smiles: ** c(c=cc1...") |
(Created page with "Category:metabolite == Metabolite 5-PHOSPHORIBOSYL-5-AMINOIMIDAZOLE == * common-name: ** 5-amino-1-(5-phospho-β-d-ribosyl)imidazole * molecular-weight: ** 294.18 * in...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 5-PHOSPHORIBOSYL-5-AMINOIMIDAZOLE == |
* common-name: | * common-name: | ||
− | ** | + | ** 5-amino-1-(5-phospho-β-d-ribosyl)imidazole |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 294.18 |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** pdacukokvhbvhj-xvfcmesisa-m |
* smiles: | * smiles: | ||
− | ** | + | ** c2([n+]=cn(c1(oc(cop([o-])(=o)[o-])c(o)c(o)1))c(n)=2) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[AIRCARBOXY-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[AIRCARBOXY-RXN]] |
+ | * [[AIRS-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=5-amino-1-(5-phospho-β-d-ribosyl)imidazole}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=294.18}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=pdacukokvhbvhj-xvfcmesisa-m}} |
Revision as of 15:07, 15 March 2021
Contents
Metabolite 5-PHOSPHORIBOSYL-5-AMINOIMIDAZOLE
- common-name:
- 5-amino-1-(5-phospho-β-d-ribosyl)imidazole
- molecular-weight:
- 294.18
- inchi-key:
- pdacukokvhbvhj-xvfcmesisa-m
- smiles:
- c2([n+]=cn(c1(oc(cop([o-])(=o)[o-])c(o)c(o)1))c(n)=2)