Difference between revisions of "B-KETOACYL-ACP"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19157 == * common-name: ** 3-oxo-(7z)-tetradecenoyl-coa * molecular-weight: ** 985.829 * inchi-key: ** bepllrgjvxaeji-twafkmgksa-j *...") |
(Created page with "Category:metabolite == Metabolite CPD-19162 == * common-name: ** (2e,9z)-hexadecenoyl-coa * molecular-weight: ** 997.883 * inchi-key: ** beqwcbbskhmrca-henmzmgosa-j * smil...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-19162 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (2e,9z)-hexadecenoyl-coa |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 997.883 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** beqwcbbskhmrca-henmzmgosa-j |
* smiles: | * smiles: | ||
| − | ** ccccccc= | + | ** ccccccc=ccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-17789]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(2e,9z)-hexadecenoyl-coa}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=997.883}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=beqwcbbskhmrca-henmzmgosa-j}} |
Revision as of 15:07, 15 March 2021
Contents
Metabolite CPD-19162
- common-name:
- (2e,9z)-hexadecenoyl-coa
- molecular-weight:
- 997.883
- inchi-key:
- beqwcbbskhmrca-henmzmgosa-j
- smiles:
- ccccccc=ccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
