Difference between revisions of "3-METHYLTHIOPROPYL-GLUCOSINOLATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-2030 == * common-name: ** glycerophosphoserine * molecular-weight: ** 258.144 * inchi-key: ** zwzwygmenqvnfu-uhnvwzdzsa-m * smiles:...")
(Created page with "Category:metabolite == Metabolite DADP == * common-name: ** dadp * molecular-weight: ** 408.18 * inchi-key: ** daeapnuqqaicnr-rrkcrqdmsa-k * smiles: ** c(c3(c(cc(n2(c1(=c(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD0-2030 ==
+
== Metabolite DADP ==
 
* common-name:
 
* common-name:
** glycerophosphoserine
+
** dadp
 
* molecular-weight:
 
* molecular-weight:
** 258.144
+
** 408.18
 
* inchi-key:
 
* inchi-key:
** zwzwygmenqvnfu-uhnvwzdzsa-m
+
** daeapnuqqaicnr-rrkcrqdmsa-k
 
* smiles:
 
* smiles:
** c(o)c(o)cop([o-])(occ([n+])c(=o)[o-])=o
+
** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op([o-])([o-])=o)([o-])=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14136]]
+
* [[DADPKIN-RXN]]
 +
* [[RXN-14192]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[ADPREDUCT-RXN]]
 +
* [[DEOXYADENYLATE-KINASE-RXN]]
 +
* [[RXN0-747]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=glycerophosphoserine}}
+
{{#set: common-name=dadp}}
{{#set: molecular-weight=258.144}}
+
{{#set: molecular-weight=408.18}}
{{#set: inchi-key=inchikey=zwzwygmenqvnfu-uhnvwzdzsa-m}}
+
{{#set: inchi-key=inchikey=daeapnuqqaicnr-rrkcrqdmsa-k}}

Revision as of 15:08, 15 March 2021

Metabolite DADP

  • common-name:
    • dadp
  • molecular-weight:
    • 408.18
  • inchi-key:
    • daeapnuqqaicnr-rrkcrqdmsa-k
  • smiles:
    • c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op([o-])([o-])=o)([o-])=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality