Difference between revisions of "Nucleotides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 18-HYDROXYOLEATE == * common-name: ** 18-hydroxyoleate * molecular-weight: ** 297.457 * inchi-key: ** lquhzvlttwmbto-uphrsurjsa-m * smile...")
(Created page with "Category:metabolite == Metabolite CROTONYL-COA == * common-name: ** crotonyl-coa * molecular-weight: ** 831.577 * inchi-key: ** kfwwcmjsysspsk-bogfjhsmsa-j * smiles: ** cc...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 18-HYDROXYOLEATE ==
+
== Metabolite CROTONYL-COA ==
 
* common-name:
 
* common-name:
** 18-hydroxyoleate
+
** crotonyl-coa
 
* molecular-weight:
 
* molecular-weight:
** 297.457
+
** 831.577
 
* inchi-key:
 
* inchi-key:
** lquhzvlttwmbto-uphrsurjsa-m
+
** kfwwcmjsysspsk-bogfjhsmsa-j
 
* smiles:
 
* smiles:
** c(o)cccccccc=ccccccccc(=o)[o-]
+
** cc=cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16402]]
+
* [[BUTYRYL-COA-DEHYDROGENASE-RXN]]
 +
* [[RXN-11667]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[BUTYRYL-COA-DEHYDROGENASE-RXN]]
 +
* [[RXN-11667]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=18-hydroxyoleate}}
+
{{#set: common-name=crotonyl-coa}}
{{#set: molecular-weight=297.457}}
+
{{#set: molecular-weight=831.577}}
{{#set: inchi-key=inchikey=lquhzvlttwmbto-uphrsurjsa-m}}
+
{{#set: inchi-key=inchikey=kfwwcmjsysspsk-bogfjhsmsa-j}}

Revision as of 15:09, 15 March 2021

Metabolite CROTONYL-COA

  • common-name:
    • crotonyl-coa
  • molecular-weight:
    • 831.577
  • inchi-key:
    • kfwwcmjsysspsk-bogfjhsmsa-j
  • smiles:
    • cc=cc(sccnc(ccnc(c(c(cop(=o)([o-])op(occ1(oc(c(c1op([o-])([o-])=o)o)n3(c=nc2(c(=nc=nc=23)n))))([o-])=o)(c)c)o)=o)=o)=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality