Difference between revisions of "4-MALEYL-ACETOACETATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite SULFOQUINOVOSYLDIACYLGLYCEROL == * common-name: ** an 6-sulfo-α-d-quinovosyl diacylglycerol == Reaction(s) known to consume the com...") |
(Created page with "Category:metabolite == Metabolite PHENYLACETATE == * common-name: ** phenylacetate * molecular-weight: ** 135.142 * inchi-key: ** wljvxdmoqogphl-uhfffaoysa-m * smiles: **...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite PHENYLACETATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** phenylacetate |
| + | * molecular-weight: | ||
| + | ** 135.142 | ||
| + | * inchi-key: | ||
| + | ** wljvxdmoqogphl-uhfffaoysa-m | ||
| + | * smiles: | ||
| + | ** c1(=cc=c(c=c1)cc([o-])=o) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[PHENDEHYD-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[PHENDEHYD-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=phenylacetate}} |
| + | {{#set: molecular-weight=135.142}} | ||
| + | {{#set: inchi-key=inchikey=wljvxdmoqogphl-uhfffaoysa-m}} | ||
Revision as of 15:11, 15 March 2021
Contents
Metabolite PHENYLACETATE
- common-name:
- phenylacetate
- molecular-weight:
- 135.142
- inchi-key:
- wljvxdmoqogphl-uhfffaoysa-m
- smiles:
- c1(=cc=c(c=c1)cc([o-])=o)
