Difference between revisions of "Aliphatic-Omega-Amino-Aldehydes"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-35 == * common-name: ** 4-acetamidobutanoate * molecular-weight: ** 144.15 * inchi-key: ** uztfmubkzqvklk-uhfffaoysa-m * smiles: ** c...")
(Created page with "Category:metabolite == Metabolite CPD-17346 == * common_name: ** 3-oxo-(11z,14z)-icosa-11,14-dienoyl-coa * smiles: ** cccccc=ccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-35 ==
+
== Metabolite CPD-17346 ==
* common-name:
+
* common_name:
** 4-acetamidobutanoate
+
** 3-oxo-(11z,14z)-icosa-11,14-dienoyl-coa
* molecular-weight:
 
** 144.15
 
* inchi-key:
 
** uztfmubkzqvklk-uhfffaoysa-m
 
 
* smiles:
 
* smiles:
** cc(=o)ncccc(=o)[o-]
+
** cccccc=ccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 +
* inchi_key:
 +
** inchikey=puwduocpcwfefg-ygyqdceasa-j
 +
* molecular_weight:
 +
** 1067.974   
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-16095]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-37]]
+
* [[RXN-16094]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-acetamidobutanoate}}
+
{{#set: common_name=3-oxo-(11z,14z)-icosa-11,14-dienoyl-coa}}
{{#set: molecular-weight=144.15}}
+
{{#set: inchi_key=inchikey=puwduocpcwfefg-ygyqdceasa-j}}
{{#set: inchi-key=inchikey=uztfmubkzqvklk-uhfffaoysa-m}}
+
{{#set: molecular_weight=1067.974    }}

Revision as of 15:13, 15 March 2021

Metabolite CPD-17346

  • common_name:
    • 3-oxo-(11z,14z)-icosa-11,14-dienoyl-coa
  • smiles:
    • cccccc=ccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi_key:
    • inchikey=puwduocpcwfefg-ygyqdceasa-j
  • molecular_weight:
    • 1067.974

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality