Difference between revisions of "CPD-7670"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17866 == * common-name: ** s-sulfinatoglutathione * molecular-weight: ** 369.364 * inchi-key: ** qubutnszzfichl-wdskdsinsa-l * smiles...") |
(Created page with "Category:metabolite == Metabolite CPD-8259 == * common-name: ** β-d-ribosylnicotinate * molecular-weight: ** 255.227 * inchi-key: ** pueddpcucprqny-zyuzmqfosa-n * smi...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-8259 == |
* common-name: | * common-name: | ||
| − | ** | + | ** β-d-ribosylnicotinate |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 255.227 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** pueddpcucprqny-zyuzmqfosa-n |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c(o)c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)[o-])c=2)) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-8443]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-14227]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=β-d-ribosylnicotinate}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=255.227}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=pueddpcucprqny-zyuzmqfosa-n}} |
Revision as of 18:59, 17 March 2021
Contents
Metabolite CPD-8259
- common-name:
- β-d-ribosylnicotinate
- molecular-weight:
- 255.227
- inchi-key:
- pueddpcucprqny-zyuzmqfosa-n
- smiles:
- c(o)c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)[o-])c=2))
