Difference between revisions of "ACETYL-COA"

Revision as of 18:59, 17 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite AMINO-HYDROXYMETHYL-METHYL-PYR-P ==
+== Metabolite CPD-7993 ==
 * common-name:
-** 4-amino-2-methyl-5-(phosphooxymethyl)pyrimidine
+** n-methylaminobutanal
 * molecular-weight:
-** 217.121
+** 102.156
 * inchi-key:
-** pkyfhkiyhbrtpi-uhfffaoysa-l
+** pjzbkcvvfptfaw-uhfffaoysa-o
 * smiles:
-** cc1(n=cc(cop(=o)([o-])[o-])=c(n=1)n)
+** c[n+]cccc=o
 == Reaction(s) known to consume the compound ==
-* [[PYRIMSYN3-RXN]]
+* [[RXN-8246]]
 == Reaction(s) known to produce the compound ==
+* [[RXN-8244]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=4-amino-2-methyl-5-(phosphooxymethyl)pyrimidine}}
+{{#set: common-name=n-methylaminobutanal}}
-{{#set: molecular-weight=217.121}}
+{{#set: molecular-weight=102.156}}
-{{#set: inchi-key=inchikey=pkyfhkiyhbrtpi-uhfffaoysa-l}}
+{{#set: inchi-key=inchikey=pjzbkcvvfptfaw-uhfffaoysa-o}}