Difference between revisions of "3-METHYLTHIOPROPYL-GLUCOSINOLATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DADP == * common-name: ** dadp * molecular-weight: ** 408.18 * inchi-key: ** daeapnuqqaicnr-rrkcrqdmsa-k * smiles: ** c(c3(c(cc(n2(c1(=c(...")
(Created page with "Category:metabolite == Metabolite STRICTOSIDINE == * common-name: ** 3-α(s)-strictosidine * molecular-weight: ** 531.581 * inchi-key: ** xbamjztxgwptrm-awtfmmiesa-o...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DADP ==
+
== Metabolite STRICTOSIDINE ==
 
* common-name:
 
* common-name:
** dadp
+
** 3-α(s)-strictosidine
 
* molecular-weight:
 
* molecular-weight:
** 408.18
+
** 531.581
 
* inchi-key:
 
* inchi-key:
** daeapnuqqaicnr-rrkcrqdmsa-k
+
** xbamjztxgwptrm-awtfmmiesa-o
 
* smiles:
 
* smiles:
** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op([o-])([o-])=o)([o-])=o
+
** c=c[ch]4([ch](c[ch]3(c2(nc1(=cc=cc=c1c=2cc[n+]3))))c(c(=o)oc)=coc4oc5(oc(c(c(c5o)o)o)co))
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DADPKIN-RXN]]
 
* [[RXN-14192]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ADPREDUCT-RXN]]
+
* [[STRICTOSIDINE-SYNTHASE-RXN]]
* [[DEOXYADENYLATE-KINASE-RXN]]
 
* [[RXN0-747]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dadp}}
+
{{#set: common-name=3-α(s)-strictosidine}}
{{#set: molecular-weight=408.18}}
+
{{#set: molecular-weight=531.581}}
{{#set: inchi-key=inchikey=daeapnuqqaicnr-rrkcrqdmsa-k}}
+
{{#set: inchi-key=inchikey=xbamjztxgwptrm-awtfmmiesa-o}}

Revision as of 19:01, 17 March 2021

Metabolite STRICTOSIDINE

  • common-name:
    • 3-α(s)-strictosidine
  • molecular-weight:
    • 531.581
  • inchi-key:
    • xbamjztxgwptrm-awtfmmiesa-o
  • smiles:
    • c=c[ch]4([ch](c[ch]3(c2(nc1(=cc=cc=c1c=2cc[n+]3))))c(c(=o)oc)=coc4oc5(oc(c(c(c5o)o)o)co))

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality