Difference between revisions of "1-AMINO-PROPAN-2-ONE-3-PHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DIAMINONONANOATE == * common-name: ** 7,8-diaminopelargonate * molecular-weight: ** 189.277 * inchi-key: ** kcegbpiygiwcdh-uhfffaoysa-o *...")
(Created page with "Category:metabolite == Metabolite CPD-4101 == * common-name: ** 24-methylidenelophenol * molecular-weight: ** 412.698 * inchi-key: ** rsmkyrdccsnyfm-aagdoflisa-n * smiles:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DIAMINONONANOATE ==
+
== Metabolite CPD-4101 ==
 
* common-name:
 
* common-name:
** 7,8-diaminopelargonate
+
** 24-methylidenelophenol
 
* molecular-weight:
 
* molecular-weight:
** 189.277
+
** 412.698
 
* inchi-key:
 
* inchi-key:
** kcegbpiygiwcdh-uhfffaoysa-o
+
** rsmkyrdccsnyfm-aagdoflisa-n
 
* smiles:
 
* smiles:
** cc(c(cccccc([o-])=o)[n+])[n+]
+
** cc(c)c(=c)ccc(c)[ch]3(cc[ch]4(c2(=cc[ch]1(c(c)c(o)ccc(c)1[ch]2ccc(c)34))))
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DAPASYN-RXN]]
 
* [[DETHIOBIOTIN-SYN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DAPASYN-RXN]]
+
* [[RXN-4161]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=7,8-diaminopelargonate}}
+
{{#set: common-name=24-methylidenelophenol}}
{{#set: molecular-weight=189.277}}
+
{{#set: molecular-weight=412.698}}
{{#set: inchi-key=inchikey=kcegbpiygiwcdh-uhfffaoysa-o}}
+
{{#set: inchi-key=inchikey=rsmkyrdccsnyfm-aagdoflisa-n}}

Revision as of 19:01, 17 March 2021

Metabolite CPD-4101

  • common-name:
    • 24-methylidenelophenol
  • molecular-weight:
    • 412.698
  • inchi-key:
    • rsmkyrdccsnyfm-aagdoflisa-n
  • smiles:
    • cc(c)c(=c)ccc(c)[ch]3(cc[ch]4(c2(=cc[ch]1(c(c)c(o)ccc(c)1[ch]2ccc(c)34))))

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality