Difference between revisions of "1-3-beta-D-Glucans"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11495 == * common-name: ** (2-hydroxyphenyl)acetate * molecular-weight: ** 151.141 * inchi-key: ** ccvyrrgzdbshfu-uhfffaoysa-m * smil...")
(Created page with "Category:metabolite == Metabolite Protein-L-Ser-or-L-Thr-P-L-Pro == * common-name: ** a protein containing a phosphorylated (l-serine/l-threonine)-l-proline motif == React...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11495 ==
+
== Metabolite Protein-L-Ser-or-L-Thr-P-L-Pro ==
 
* common-name:
 
* common-name:
** (2-hydroxyphenyl)acetate
+
** a protein containing a phosphorylated (l-serine/l-threonine)-l-proline motif
* molecular-weight:
 
** 151.141
 
* inchi-key:
 
** ccvyrrgzdbshfu-uhfffaoysa-m
 
* smiles:
 
** c(=o)([o-])cc1(=c(o)c=cc=c1)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[2.7.11.24-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10815]]
+
* [[2.7.11.24-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2-hydroxyphenyl)acetate}}
+
{{#set: common-name=a protein containing a phosphorylated (l-serine/l-threonine)-l-proline motif}}
{{#set: molecular-weight=151.141}}
 
{{#set: inchi-key=inchikey=ccvyrrgzdbshfu-uhfffaoysa-m}}
 

Revision as of 19:01, 17 March 2021

Metabolite Protein-L-Ser-or-L-Thr-P-L-Pro

  • common-name:
    • a protein containing a phosphorylated (l-serine/l-threonine)-l-proline motif

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality