Difference between revisions of "Aliphatic-Omega-Amino-Aldehydes"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17346 == * common_name: ** 3-oxo-(11z,14z)-icosa-11,14-dienoyl-coa * smiles: ** cccccc=ccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(...")
(Created page with "Category:metabolite == Metabolite CPD-17273 == * common-name: ** 1-stearoyl-2-palmitoyl-sn-glycerol 3-phosphate * molecular-weight: ** 674.937 * inchi-key: ** usqmhzsvxzak...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17346 ==
+
== Metabolite CPD-17273 ==
* common_name:
+
* common-name:
** 3-oxo-(11z,14z)-icosa-11,14-dienoyl-coa
+
** 1-stearoyl-2-palmitoyl-sn-glycerol 3-phosphate
 +
* molecular-weight:
 +
** 674.937
 +
* inchi-key:
 +
** usqmhzsvxzakai-pgufjcewsa-l
 
* smiles:
 
* smiles:
** cccccc=ccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cccccccccccccccccc(occ(oc(=o)ccccccccccccccc)cop([o-])(=o)[o-])=o
* inchi_key:
 
** inchikey=puwduocpcwfefg-ygyqdceasa-j
 
* molecular_weight:
 
** 1067.974   
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16095]]
+
* [[RXN-16030]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16094]]
+
* [[RXN-16030]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common_name=3-oxo-(11z,14z)-icosa-11,14-dienoyl-coa}}
+
{{#set: common-name=1-stearoyl-2-palmitoyl-sn-glycerol 3-phosphate}}
{{#set: inchi_key=inchikey=puwduocpcwfefg-ygyqdceasa-j}}
+
{{#set: molecular-weight=674.937}}
{{#set: molecular_weight=1067.974    }}
+
{{#set: inchi-key=inchikey=usqmhzsvxzakai-pgufjcewsa-l}}

Revision as of 19:03, 17 March 2021

Metabolite CPD-17273

  • common-name:
    • 1-stearoyl-2-palmitoyl-sn-glycerol 3-phosphate
  • molecular-weight:
    • 674.937
  • inchi-key:
    • usqmhzsvxzakai-pgufjcewsa-l
  • smiles:
    • cccccccccccccccccc(occ(oc(=o)ccccccccccccccc)cop([o-])(=o)[o-])=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality